Protophomine
| Internal ID | eb45444e-1b6c-422e-b6ef-364bc2b29bda |
| Taxonomy | Organoheterocyclic compounds > Isoindoles and derivatives > Isoindolines > Isoindolones |
| IUPAC Name | (3E,11E)-18-benzyl-9,15,16-trimethyl-19-azatricyclo[11.7.0.01,17]icosa-3,11,15-triene-2,14,20-trione |
| SMILES (Canonical) | CC1CCCCC=CC(=O)C23C(C=CC1)C(=O)C(=C(C2C(NC3=O)CC4=CC=CC=C4)C)C |
| SMILES (Isomeric) | CC1CCCC/C=C/C(=O)C23C(/C=C/C1)C(=O)C(=C(C2C(NC3=O)CC4=CC=CC=C4)C)C |
| InChI | InChI=1S/C29H35NO3/c1-19-12-7-4-5-10-17-25(31)29-23(16-11-13-19)27(32)21(3)20(2)26(29)24(30-28(29)33)18-22-14-8-6-9-15-22/h6,8-11,14-17,19,23-24,26H,4-5,7,12-13,18H2,1-3H3,(H,30,33)/b16-11+,17-10+ |
| InChI Key | NNDRVGKCDJPTHD-XAXODXSJSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C29H35NO3 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.26169398 g/mol |
| Topological Polar Surface Area (TPSA) | 63.20 Ų |
| XlogP | 5.60 |
| 52212-93-8 |
| 16-Methyl-10-phenyl-(13)-cytochalasa-5(6),13,21-trien-1,7,23-trione |
| (13)Cytochalasa-5,13,21-triene-1,7,23-trione, 16-methyl-10-phenyl-, (13E,16R,21E)- |
| (3E,11E)-18-benzyl-9,15,16-trimethyl-19-azatricyclo[11.7.0.01,17]icosa-3,11,15-triene-2,14,20-trione |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.23% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.88% | 95.56% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 96.03% | 97.64% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.63% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.45% | 96.09% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 90.26% | 96.25% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.32% | 93.99% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.24% | 97.09% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 88.04% | 94.62% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.69% | 94.45% |
| CHEMBL4072 | P07858 | Cathepsin B | 83.81% | 93.67% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 82.34% | 94.23% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.17% | 95.50% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.87% | 93.00% |
| CHEMBL4523377 | Q86WV6 | Stimulator of interferon genes protein | 80.64% | 95.48% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.08% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 6450303 |
| LOTUS | LTS0079905 |
| wikiData | Q77380983 |