Protocatechuic acid 4-glucoside
Internal ID | d76e4445-04dd-4c4a-b989-3ed0353ef7b1 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
IUPAC Name | 3-hydroxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoic acid |
SMILES (Canonical) | C1=CC(=C(C=C1C(=O)O)O)OC2C(C(C(C(O2)CO)O)O)O |
SMILES (Isomeric) | C1=CC(=C(C=C1C(=O)O)O)OC2C(C(C(C(O2)CO)O)O)O |
InChI | InChI=1S/C13H16O9/c14-4-8-9(16)10(17)11(18)13(22-8)21-7-2-1-5(12(19)20)3-6(7)15/h1-3,8-11,13-18H,4H2,(H,19,20) |
InChI Key | HFFREILXLCWCQH-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C13H16O9 |
Molecular Weight | 316.26 g/mol |
Exact Mass | 316.07943208 g/mol |
Topological Polar Surface Area (TPSA) | 157.00 Ų |
XlogP | -1.80 |
Protocatechuic acid 4-O-glucoside |
DTXSID301341731 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3194 | P02766 | Transthyretin | 96.77% | 90.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.34% | 99.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.84% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.77% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.01% | 96.09% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 84.80% | 90.20% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.16% | 96.00% |
CHEMBL1811 | P34995 | Prostanoid EP1 receptor | 82.11% | 95.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.06% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.35% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.71% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.69% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Picea glauca |
Ribes rubrum |
PubChem | 157010113 |
LOTUS | LTS0074315 |
wikiData | Q105027280 |