Prostaglandin F2a;PGF2alpha
Internal ID | 73578a1f-b870-4c3f-9367-835bb3dbd1e4 |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Eicosanoids > Prostaglandins and related compounds |
IUPAC Name | 7-[3,5-dihydroxy-2-(3-hydroxyoct-1-enyl)cyclopentyl]hept-5-enoic acid |
SMILES (Canonical) | CCCCCC(C=CC1C(CC(C1CC=CCCCC(=O)O)O)O)O |
SMILES (Isomeric) | CCCCCC(C=CC1C(CC(C1CC=CCCCC(=O)O)O)O)O |
InChI | InChI=1S/C20H34O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,12-13,15-19,21-23H,2-3,5-6,8-11,14H2,1H3,(H,24,25) |
InChI Key | PXGPLTODNUVGFL-UHFFFAOYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C20H34O5 |
Molecular Weight | 354.50 g/mol |
Exact Mass | 354.24062418 g/mol |
Topological Polar Surface Area (TPSA) | 98.00 Ų |
XlogP | 2.70 |
Atomic LogP (AlogP) | 3.04 |
H-Bond Acceptor | 4 |
H-Bond Donor | 4 |
Rotatable Bonds | 12 |
146388-90-1 |
MLS003107056 |
583E |
SMR001821937 |
7-[3,5-Dihydroxy-2-(3-hydroxy-oct-1-enyl)-cyclopentyl]-hept-5-enoic acid |
CHEMBL2220614 |
BDBM97180 |
cid_44134913 |
38432-87-0 |
7-[3,5-dihydroxy-2-(3-hydroxyoct-1-enyl)cyclopentyl]hept-5-enoic acid |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9523 | 95.23% |
Caco-2 | - | 0.7551 | 75.51% |
Blood Brain Barrier | - | 0.8500 | 85.00% |
Human oral bioavailability | - | 0.7000 | 70.00% |
Subcellular localzation | Mitochondria | 0.7055 | 70.55% |
OATP2B1 inhibitior | - | 0.8554 | 85.54% |
OATP1B1 inhibitior | + | 0.7575 | 75.75% |
OATP1B3 inhibitior | + | 0.9375 | 93.75% |
MATE1 inhibitior | - | 1.0000 | 100.00% |
OCT2 inhibitior | - | 0.9338 | 93.38% |
BSEP inhibitior | - | 0.5162 | 51.62% |
P-glycoprotein inhibitior | - | 0.8289 | 82.89% |
P-glycoprotein substrate | - | 0.6775 | 67.75% |
CYP3A4 substrate | + | 0.6000 | 60.00% |
CYP2C9 substrate | - | 0.5844 | 58.44% |
CYP2D6 substrate | - | 0.8663 | 86.63% |
CYP3A4 inhibition | - | 0.7994 | 79.94% |
CYP2C9 inhibition | - | 0.9105 | 91.05% |
CYP2C19 inhibition | - | 0.8133 | 81.33% |
CYP2D6 inhibition | - | 0.9211 | 92.11% |
CYP1A2 inhibition | - | 0.8299 | 82.99% |
CYP2C8 inhibition | - | 0.7842 | 78.42% |
CYP inhibitory promiscuity | - | 0.9098 | 90.98% |
UGT catelyzed | + | 0.7000 | 70.00% |
Carcinogenicity (binary) | - | 0.9500 | 95.00% |
Carcinogenicity (trinary) | Non-required | 0.7417 | 74.17% |
Eye corrosion | - | 0.9929 | 99.29% |
Eye irritation | - | 0.9676 | 96.76% |
Skin irritation | + | 0.5928 | 59.28% |
Skin corrosion | - | 0.8625 | 86.25% |
Ames mutagenesis | - | 0.8478 | 84.78% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.3943 | 39.43% |
Micronuclear | - | 0.9700 | 97.00% |
Hepatotoxicity | - | 0.8446 | 84.46% |
skin sensitisation | - | 0.7406 | 74.06% |
Respiratory toxicity | + | 0.8778 | 87.78% |
Reproductive toxicity | + | 0.9778 | 97.78% |
Mitochondrial toxicity | + | 0.8750 | 87.50% |
Nephrotoxicity | - | 0.8449 | 84.49% |
Acute Oral Toxicity (c) | III | 0.8014 | 80.14% |
Estrogen receptor binding | + | 0.8906 | 89.06% |
Androgen receptor binding | + | 0.6075 | 60.75% |
Thyroid receptor binding | - | 0.5578 | 55.78% |
Glucocorticoid receptor binding | + | 0.7569 | 75.69% |
Aromatase binding | - | 0.8149 | 81.49% |
PPAR gamma | + | 0.6959 | 69.59% |
Honey bee toxicity | - | 0.9384 | 93.84% |
Biodegradation | - | 0.5500 | 55.00% |
Crustacea aquatic toxicity | + | 0.5500 | 55.00% |
Fish aquatic toxicity | + | 0.9769 | 97.69% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1811 | P34995 | Prostanoid EP1 receptor |
380 nM |
IC50 |
via Super-PRED
|
CHEMBL3710 | P43115 | Prostanoid EP3 receptor |
322 nM |
IC50 |
via Super-PRED
|
CHEMBL1987 | P43088 | Prostanoid FP receptor |
2.5 nM |
IC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 97.13% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.83% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.77% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.85% | 97.25% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.05% | 93.56% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 90.13% | 89.63% |
CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 89.92% | 96.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.56% | 91.11% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 87.38% | 92.08% |
CHEMBL1781 | P11387 | DNA topoisomerase I | 87.18% | 97.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.05% | 91.19% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.97% | 96.47% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.92% | 97.09% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 86.64% | 83.82% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.37% | 100.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.74% | 100.00% |
CHEMBL1881 | P43116 | Prostanoid EP2 receptor | 84.62% | 93.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.33% | 85.14% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 82.71% | 95.58% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 82.55% | 100.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.41% | 92.50% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 81.95% | 92.32% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.88% | 89.50% |
CHEMBL4330 | Q9NS75 | Cysteinyl leukotriene receptor 2 | 81.82% | 98.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.80% | 90.71% |
CHEMBL299 | P17252 | Protein kinase C alpha | 81.78% | 98.03% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 81.35% | 82.50% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 81.23% | 97.50% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.40% | 90.17% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 80.00% | 97.29% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Larix sibirica |
PubChem | 160 |
LOTUS | LTS0127299 |
wikiData | Q105216172 |