prostaglandin F1a
| Internal ID | 974cb113-00d5-4c87-8d72-8f2949300fd7 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Eicosanoids > Prostaglandins and related compounds |
| IUPAC Name | 7-[3,5-dihydroxy-2-(3-hydroxyoct-1-enyl)cyclopentyl]heptanoic acid |
| SMILES (Canonical) | CCCCCC(C=CC1C(CC(C1CCCCCCC(=O)O)O)O)O |
| SMILES (Isomeric) | CCCCCC(C=CC1C(CC(C1CCCCCCC(=O)O)O)O)O |
| InChI | InChI=1S/C20H36O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h12-13,15-19,21-23H,2-11,14H2,1H3,(H,24,25) |
| InChI Key | DZUXGQBLFALXCR-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C20H36O5 |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.25627424 g/mol |
| Topological Polar Surface Area (TPSA) | 98.00 Ų |
| XlogP | 3.50 |
| SCHEMBL11816351 |
| DTXSID90862396 |
| CHEBI:169746 |
| 7-[3,5-dihydroxy-2-(3-hydroxyoct-1-enyl)cyclopentyl]heptanoic acid |
| FT-0603509 |
| FT-0636650 |
| FT-0638635 |
| FT-0639409 |
| 9,11,15-trihydroxyprost-13-en-1-oic acid |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.73% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.97% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.37% | 99.17% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 93.68% | 89.63% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 93.32% | 93.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.55% | 91.11% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 90.02% | 96.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 89.53% | 100.00% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 89.45% | 92.08% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.37% | 91.19% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 87.78% | 85.94% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 87.69% | 98.03% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.28% | 97.09% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 87.17% | 100.00% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 86.89% | 83.82% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.65% | 85.14% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 86.58% | 97.29% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.67% | 92.50% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.57% | 90.71% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.14% | 95.50% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 84.05% | 95.17% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 83.99% | 92.32% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 83.64% | 100.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.01% | 97.25% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.98% | 90.17% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 82.74% | 82.50% |
| CHEMBL4330 | Q9NS75 | Cysteinyl leukotriene receptor 2 | 82.25% | 98.00% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 82.25% | 91.81% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 81.70% | 98.33% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 81.12% | 96.47% |
| CHEMBL3629 | P68400 | Casein kinase II alpha | 80.70% | 98.89% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 80.37% | 85.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Larix sibirica |
| PubChem | 4957 |
| LOTUS | LTS0083043 |
| wikiData | Q104992040 |