Propionicin T1
| Internal ID | 22d56236-a528-4fd3-9db1-ba7241a67351 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | 1-(2-amino-3-methylbutanoyl)-N-[2-[[2-[[1-[[1-[[1-[[1-[[5-(diaminomethylideneamino)-1-[(1-hydroxy-3-oxopropan-2-yl)amino]-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxobutan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxobutan-2-yl]amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]pyrrolidine-2-carboxamide |
| SMILES (Canonical) | CC(C)C(C(=O)N1CCCC1C(=O)NCC(=O)NCC(=O)NC(CS)C(=O)NC(C(C)O)C(=O)NC(CC2=CC=C(C=C2)O)C(=O)NC(C(C)O)C(=O)NC(CCCN=C(N)N)C(=O)NC(CO)C=O)N |
| SMILES (Isomeric) | CC(C)C(C(=O)N1CCCC1C(=O)NCC(=O)NCC(=O)NC(CS)C(=O)NC(C(C)O)C(=O)NC(CC2=CC=C(C=C2)O)C(=O)NC(C(C)O)C(=O)NC(CCCN=C(N)N)C(=O)NC(CO)C=O)N |
| InChI | InChI=1S/C43H69N13O14S/c1-21(2)33(44)42(70)56-14-6-8-30(56)39(67)49-16-31(62)48-17-32(63)51-29(20-71)38(66)55-35(23(4)60)41(69)53-28(15-24-9-11-26(61)12-10-24)37(65)54-34(22(3)59)40(68)52-27(7-5-13-47-43(45)46)36(64)50-25(18-57)19-58/h9-12,18,21-23,25,27-30,33-35,58-61,71H,5-8,13-17,19-20,44H2,1-4H3,(H,48,62)(H,49,67)(H,50,64)(H,51,63)(H,52,68)(H,53,69)(H,54,65)(H,55,66)(H4,45,46,47) |
| InChI Key | NAVBNQZIHYIONI-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C43H69N13O14S |
| Molecular Weight | 1024.20 g/mol |
| Exact Mass | 1023.48076510 g/mol |
| Topological Polar Surface Area (TPSA) | 443.00 Ų |
| XlogP | -4.90 |
| Atomic LogP (AlogP) | -7.01 |
| H-Bond Acceptor | 17 |
| H-Bond Donor | 16 |
| Rotatable Bonds | 29 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.8521 | 85.21% |
| Caco-2 | - | 0.8647 | 86.47% |
| Blood Brain Barrier | - | 0.8000 | 80.00% |
| Human oral bioavailability | - | 0.7000 | 70.00% |
| Subcellular localzation | Mitochondria | 0.6708 | 67.08% |
| OATP2B1 inhibitior | - | 0.8576 | 85.76% |
| OATP1B1 inhibitior | + | 0.8420 | 84.20% |
| OATP1B3 inhibitior | + | 0.9385 | 93.85% |
| MATE1 inhibitior | - | 0.8000 | 80.00% |
| OCT2 inhibitior | - | 0.5250 | 52.50% |
| BSEP inhibitior | + | 0.9313 | 93.13% |
| P-glycoprotein inhibitior | + | 0.7415 | 74.15% |
| P-glycoprotein substrate | + | 0.8672 | 86.72% |
| CYP3A4 substrate | + | 0.7236 | 72.36% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.7924 | 79.24% |
| CYP3A4 inhibition | - | 0.8370 | 83.70% |
| CYP2C9 inhibition | - | 0.8970 | 89.70% |
| CYP2C19 inhibition | - | 0.8262 | 82.62% |
| CYP2D6 inhibition | - | 0.9050 | 90.50% |
| CYP1A2 inhibition | - | 0.8788 | 87.88% |
| CYP2C8 inhibition | + | 0.6898 | 68.98% |
| CYP inhibitory promiscuity | - | 0.9712 | 97.12% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.8600 | 86.00% |
| Carcinogenicity (trinary) | Non-required | 0.6183 | 61.83% |
| Eye corrosion | - | 0.9862 | 98.62% |
| Eye irritation | - | 0.8987 | 89.87% |
| Skin irritation | - | 0.7577 | 75.77% |
| Skin corrosion | - | 0.9228 | 92.28% |
| Ames mutagenesis | - | 0.6878 | 68.78% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6892 | 68.92% |
| Micronuclear | + | 0.8600 | 86.00% |
| Hepatotoxicity | - | 0.6226 | 62.26% |
| skin sensitisation | - | 0.8447 | 84.47% |
| Respiratory toxicity | + | 0.8111 | 81.11% |
| Reproductive toxicity | + | 0.9556 | 95.56% |
| Mitochondrial toxicity | + | 0.8750 | 87.50% |
| Nephrotoxicity | - | 0.6359 | 63.59% |
| Acute Oral Toxicity (c) | III | 0.5869 | 58.69% |
| Estrogen receptor binding | + | 0.7647 | 76.47% |
| Androgen receptor binding | + | 0.6963 | 69.63% |
| Thyroid receptor binding | + | 0.5541 | 55.41% |
| Glucocorticoid receptor binding | - | 0.4725 | 47.25% |
| Aromatase binding | + | 0.6653 | 66.53% |
| PPAR gamma | + | 0.7413 | 74.13% |
| Honey bee toxicity | - | 0.7605 | 76.05% |
| Biodegradation | - | 0.7500 | 75.00% |
| Crustacea aquatic toxicity | - | 0.6000 | 60.00% |
| Fish aquatic toxicity | - | 0.5000 | 50.00% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.91% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 99.35% | 94.45% |
| CHEMBL3837 | P07711 | Cathepsin L | 98.68% | 96.61% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 98.61% | 100.00% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 98.30% | 93.10% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 98.15% | 98.33% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 97.79% | 96.67% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.27% | 96.09% |
| CHEMBL236 | P41143 | Delta opioid receptor | 96.42% | 99.35% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 95.88% | 100.00% |
| CHEMBL4801 | P29466 | Caspase-1 | 95.40% | 96.85% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.29% | 99.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.03% | 91.11% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 95.00% | 95.38% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 94.76% | 97.23% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 94.73% | 89.63% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 94.57% | 90.00% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 94.07% | 96.67% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 94.03% | 95.89% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 93.86% | 90.71% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 93.83% | 90.24% |
| CHEMBL2535 | P11166 | Glucose transporter | 93.36% | 98.75% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 92.95% | 89.33% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 92.89% | 90.20% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 92.86% | 94.66% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 92.26% | 95.89% |
| CHEMBL233 | P35372 | Mu opioid receptor | 91.86% | 97.93% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.76% | 97.09% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 90.62% | 95.52% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 90.54% | 95.00% |
| CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 90.49% | 83.14% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 90.28% | 96.03% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.92% | 95.56% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 89.77% | 93.00% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 89.38% | 88.42% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.70% | 91.19% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 87.42% | 96.67% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.38% | 93.56% |
| CHEMBL249 | P25103 | Neurokinin 1 receptor | 87.15% | 99.17% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 87.08% | 91.81% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 86.90% | 93.18% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 86.67% | 82.38% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 86.54% | 90.08% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.15% | 96.00% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 86.06% | 97.64% |
| CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 85.22% | 93.33% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.20% | 100.00% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 84.95% | 97.29% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 84.64% | 98.10% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.15% | 100.00% |
| CHEMBL4393 | P39900 | Matrix metalloproteinase 12 | 83.69% | 92.22% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 83.43% | 96.37% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.32% | 96.47% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 83.20% | 97.64% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 81.98% | 98.94% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 81.96% | 82.86% |
| CHEMBL204 | P00734 | Thrombin | 80.68% | 96.01% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.13% | 85.00% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 80.10% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139585141 |
| LOTUS | LTS0184863 |
| wikiData | Q77384705 |