Propenylguaiacol
| Internal ID | a3da358f-76c1-43cf-b70a-e91e6b8fb9e7 |
| Taxonomy | Benzenoids > Phenols > Methoxyphenols |
| IUPAC Name | 2-methoxy-4-prop-1-enylphenol |
| SMILES (Canonical) | CC=CC1=CC(=C(C=C1)O)OC |
| SMILES (Isomeric) | CC=CC1=CC(=C(C=C1)O)OC |
| InChI | InChI=1S/C10H12O2/c1-3-4-8-5-6-9(11)10(7-8)12-2/h3-7,11H,1-2H3 |
| InChI Key | BJIOGJUNALELMI-UHFFFAOYSA-N |
| Popularity | 255 references in papers |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.083729621 g/mol |
| Topological Polar Surface Area (TPSA) | 29.50 Ų |
| XlogP | 2.60 |
| 2-methoxy-4-prop-1-enylphenol |
| CHEBI:18224 |
| 2-methoxy-4-propenyl-Phenol |
| Phenol, 2-methoxy-4-(propenyl)- |
| DTXSID7022413 |
| Epitope ID:114092 |
| 4-propenyl-2-methoxyphenol |
| CIS/TRANS-ISOEUGENOL |
| 4-isopropenyl-2-methoxy-phenol |
| CHEMBL2135887 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.01% | 91.11% |
| CHEMBL3194 | P02766 | Transthyretin | 93.41% | 90.71% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 92.82% | 91.49% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.59% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.42% | 96.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.40% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.23% | 96.09% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.96% | 89.62% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 86.84% | 90.24% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.54% | 90.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.90% | 98.75% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.35% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.65% | 94.45% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 81.52% | 98.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cinnamomum kotoense |
| Clinopodium gilliesii |
| Mandragora officinarum |
| Neomirandea guevarii |
| Origanum sipyleum |
| Perilla frutescens |
| Petunia axillaris |
| Syzygium aromaticum |
| Valeriana officinalis |
| PubChem | 7338 |
| LOTUS | LTS0086128 |
| wikiData | Q420043 |