Prodelphinidin A1
Internal ID | 58b6e344-763a-4ac5-9228-76b5de989942 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Biflavonoids and polyflavonoids |
IUPAC Name | 5,13-bis(3,4,5-trihydroxyphenyl)-4,12,14-trioxapentacyclo[11.7.1.02,11.03,8.015,20]henicosa-2(11),3(8),9,15,17,19-hexaene-6,9,17,19,21-pentol |
SMILES (Canonical) | C1C(C(OC2=C1C(=CC3=C2C4C(C(O3)(OC5=CC(=CC(=C45)O)O)C6=CC(=C(C(=C6)O)O)O)O)O)C7=CC(=C(C(=C7)O)O)O)O |
SMILES (Isomeric) | C1C(C(OC2=C1C(=CC3=C2C4C(C(O3)(OC5=CC(=CC(=C45)O)O)C6=CC(=C(C(=C6)O)O)O)O)O)C7=CC(=C(C(=C7)O)O)O)O |
InChI | InChI=1S/C30H24O14/c31-11-5-14(33)22-20(6-11)43-30(10-3-17(36)26(40)18(37)4-10)29(41)24(22)23-21(44-30)8-13(32)12-7-19(38)27(42-28(12)23)9-1-15(34)25(39)16(35)2-9/h1-6,8,19,24,27,29,31-41H,7H2 |
InChI Key | SJDDGZBVGOKCKT-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H24O14 |
Molecular Weight | 608.50 g/mol |
Exact Mass | 608.11660544 g/mol |
Topological Polar Surface Area (TPSA) | 250.00 Ų |
XlogP | 1.70 |
5,13-bis(3,4,5-trihydroxyphenyl)-4,12,14-trioxapentacyclo[11.7.1.02,11.03,8.015,20]henicosa-2(11),3(8),9,15,17,19-hexaene-6,9,17,19,21-pentol |
SCHEMBL17548764 |
Epigallocatechin-(2b->7,4b->8)-gallocatechin |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.66% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.66% | 96.09% |
CHEMBL233 | P35372 | Mu opioid receptor | 93.41% | 97.93% |
CHEMBL236 | P41143 | Delta opioid receptor | 92.38% | 99.35% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.61% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.58% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 86.88% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.81% | 94.45% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.59% | 92.94% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 84.39% | 85.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.87% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.51% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.47% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.23% | 95.89% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.71% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Phyllanthus emblica |
PubChem | 14521015 |
LOTUS | LTS0141412 |
wikiData | Q105254228 |