Preaspernidgulene A1
| Internal ID | 25a37603-9143-4d36-ae8d-1e0ba03fe0ee |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
| IUPAC Name | 13-[(2R,3S)-4-hydroxy-3,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl]-3,5,7-trimethyltetradeca-2,4,6,8,10,12-hexaenoic acid |
| SMILES (Canonical) | CC1C(OC(=O)C(=C1O)C)C(=CC=CC=CC(=CC(=CC(=CC(=O)O)C)C)C)C |
| SMILES (Isomeric) | C[C@H]1[C@@H](OC(=O)C(=C1O)C)C(=CC=CC=CC(=CC(=CC(=CC(=O)O)C)C)C)C |
| InChI | InChI=1S/C24H30O5/c1-15(12-16(2)13-17(3)14-21(25)26)10-8-7-9-11-18(4)23-19(5)22(27)20(6)24(28)29-23/h7-14,19,23,27H,1-6H3,(H,25,26)/t19-,23+/m1/s1 |
| InChI Key | PZEYJJNSSWZZBI-XXBNENTESA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C24H30O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.20932405 g/mol |
| Topological Polar Surface Area (TPSA) | 83.80 Ų |
| XlogP | 6.30 |
| 13-[(2R,3S)-4-hydroxy-3,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl]-3,5,7-trimethyltetradeca-2,4,6,8,10,12-hexaenoic acid |
| 13-((2R,3S)-4-hydroxy-3,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl)-3,5,7-trimethyltetradeca-2,4,6,8,10,12-hexaenoic acid |
| 13-((2R,3S)-4-Hydroxy-3,5-dimethyl-6-oxo-3,6-dihydro-2H-pyran-2-yl)-3,5,7-trimethyltetradeca-2,4,6,8,10,12-hexaenoate |
| 13-[(2R,3S)-4-Hydroxy-3,5-dimethyl-6-oxo-3,6-dihydro-2H-pyran-2-yl]-3,5,7-trimethyltetradeca-2,4,6,8,10,12-hexaenoate |
| RefChem:175769 |
| CHEBI:227071 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.55% | 83.82% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 92.30% | 94.73% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.00% | 95.56% |
| CHEMBL1870 | P28702 | Retinoid X receptor beta | 90.83% | 95.00% |
| CHEMBL2061 | P19793 | Retinoid X receptor alpha | 89.85% | 91.67% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.26% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.77% | 89.00% |
| CHEMBL2004 | P48443 | Retinoid X receptor gamma | 83.86% | 100.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.83% | 86.33% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.80% | 95.50% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.79% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.91% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146682297 |
| LOTUS | LTS0082065 |
| wikiData | Q105216942 |