Porson
Internal ID | ab643ce2-962d-4f90-906b-c05cb33774ed |
Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Cyclic diarylheptanoids > Meta,meta-bridged biphenyls |
IUPAC Name | 3,8-dihydroxy-15,16,17-trimethoxytricyclo[12.3.1.12,6]nonadeca-1(17),2,4,6(19),14(18),15-hexaen-9-one |
SMILES (Canonical) | COC1=C(C(=C2C=C1CCCCC(=O)C(CC3=CC2=C(C=C3)O)O)OC)OC |
SMILES (Isomeric) | COC1=C(C(=C2C=C1CCCCC(=O)C(CC3=CC2=C(C=C3)O)O)OC)OC |
InChI | InChI=1S/C22H26O6/c1-26-20-14-6-4-5-7-18(24)19(25)11-13-8-9-17(23)15(10-13)16(12-14)21(27-2)22(20)28-3/h8-10,12,19,23,25H,4-7,11H2,1-3H3 |
InChI Key | IFQDEGDKLBEYHN-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H26O6 |
Molecular Weight | 386.40 g/mol |
Exact Mass | 386.17293854 g/mol |
Topological Polar Surface Area (TPSA) | 85.20 Ų |
XlogP | 3.40 |
56222-03-8 |
Porsone |
(-)-Porson; Porson |
CHEBI:172106 |
AKOS040762820 |
FS-10014 |
3,8-dihydroxy-15,16,17-trimethoxytricyclo[12.3.1.12,6]nonadeca-1(17),2,4,6(19),14(18),15-hexaen-9-one |
![2D Structure of Porson 2D Structure of Porson](https://plantaedb.com/storage/docs/compounds/2023/11/porson.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.76% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.61% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 95.83% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.26% | 96.09% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 92.63% | 83.82% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.58% | 95.56% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.91% | 93.99% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.36% | 86.33% |
CHEMBL2535 | P11166 | Glucose transporter | 87.88% | 98.75% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.88% | 90.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.82% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.54% | 94.00% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 84.68% | 96.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.69% | 99.15% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.37% | 89.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.75% | 90.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.52% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Myrica gale |
PubChem | 85180765 |
LOTUS | LTS0270827 |
wikiData | Q105112311 |