Podolide
Internal ID | 83e38e1f-64fc-4619-a8f3-2bae63025b2d |
Taxonomy | Organoheterocyclic compounds > Naphthopyrans |
IUPAC Name | (1S,2R,4R,5R,10S,14S,17R)-10,14-dimethyl-5-propan-2-yl-3,6,16-trioxapentacyclo[8.6.1.02,4.04,9.014,17]heptadeca-8,12-diene-7,15-dione |
SMILES (Canonical) | CC(C)C1C23C(O2)C4C5C(C3=CC(=O)O1)(CC=CC5(C(=O)O4)C)C |
SMILES (Isomeric) | CC(C)[C@@H]1[C@]23[C@H](O2)[C@@H]4[C@@H]5[C@@](C3=CC(=O)O1)(CC=C[C@@]5(C(=O)O4)C)C |
InChI | InChI=1S/C19H22O5/c1-9(2)14-19-10(8-11(20)22-14)17(3)6-5-7-18(4)13(17)12(15(19)24-19)23-16(18)21/h5,7-9,12-15H,6H2,1-4H3/t12-,13+,14+,15+,17+,18-,19+/m0/s1 |
InChI Key | NGMZHPQMBVXJMC-DXNUVPBBSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C19H22O5 |
Molecular Weight | 330.40 g/mol |
Exact Mass | 330.14672380 g/mol |
Topological Polar Surface Area (TPSA) | 65.10 Ų |
XlogP | 2.30 |
55786-36-2 |
CHEBI:8279 |
(1S,2R,4R,5R,10S,14S,17R)-10,14-dimethyl-5-propan-2-yl-3,6,16-trioxapentacyclo[8.6.1.02,4.04,9.014,17]heptadeca-8,12-diene-7,15-dione |
CHEMBL465652 |
Podolactone B, 1,2-deepoxy-2,3-didehydro-3,15,16-trideoxy- |
C09173 |
NSC 238978 |
Q27108037 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.77% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.01% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.48% | 95.56% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 88.05% | 96.38% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 86.40% | 96.61% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.00% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 85.76% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.62% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.03% | 97.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 83.58% | 96.77% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.56% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.45% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.37% | 89.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.57% | 99.23% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.45% | 97.14% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 81.03% | 97.79% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.40% | 92.88% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 80.34% | 95.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Afrocarpus gracilior |
PubChem | 99535 |
LOTUS | LTS0083150 |
wikiData | Q27108037 |