Plocamene E
| Internal ID | 7a854395-c860-46ce-ab0a-aa2862de61ab |
| Taxonomy | Organohalogen compounds > Vinyl halides > Vinyl chlorides |
| IUPAC Name | (1R,2S,4S)-1,2-dichloro-4-[(E)-2-chloroethenyl]-1-methyl-5-methylidenecyclohexane |
| SMILES (Canonical) | CC1(CC(=C)C(CC1Cl)C=CCl)Cl |
| SMILES (Isomeric) | C[C@]1(CC(=C)[C@@H](C[C@@H]1Cl)/C=C/Cl)Cl |
| InChI | InChI=1S/C10H13Cl3/c1-7-6-10(2,13)9(12)5-8(7)3-4-11/h3-4,8-9H,1,5-6H2,2H3/b4-3+/t8-,9+,10-/m1/s1 |
| InChI Key | VBPRIDXMLSACHK-DXQGWMINSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C10H13Cl3 |
| Molecular Weight | 239.60 g/mol |
| Exact Mass | 238.008283 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 3.70 |
| 63866-51-3 |
| (1R,2S,4S)-1,2-dichloro-4-[(E)-2-chloroethenyl]-1-methyl-5-methylidenecyclohexane |
| CHEBI:80934 |
| DTXSID601134254 |
| NSC 305225 |
| C17108 |
| Q27151435 |
| (1R,2S,4S)-1,2-Dichloro-4-[(1E)-2-chloroethenyl]-1-methyl-5-methylenecyclohexane |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.13% | 90.17% |
| CHEMBL240 | Q12809 | HERG | 94.74% | 89.76% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.30% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.10% | 91.11% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 88.84% | 85.30% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 86.48% | 89.34% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.08% | 94.75% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 83.07% | 92.86% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.82% | 95.89% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.74% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 6443195 |
| LOTUS | LTS0214377 |
| wikiData | Q27151435 |