Platycerine
| Internal ID | 8e70b7f6-384e-430a-8e9a-78db62a3ef01 |
| Taxonomy | Alkaloids and derivatives > Pavine alkaloids |
| IUPAC Name | 4,12,13-trimethoxy-17-methyl-17-azatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10,12,14-hexaen-3-ol |
| SMILES (Canonical) | CN1C2CC3=C(C1CC4=CC(=C(C=C24)OC)OC)C(=C(C=C3)OC)O |
| SMILES (Isomeric) | CN1C2CC3=C(C1CC4=CC(=C(C=C24)OC)OC)C(=C(C=C3)OC)O |
| InChI | InChI=1S/C20H23NO4/c1-21-14-7-11-5-6-16(23-2)20(22)19(11)15(21)8-12-9-17(24-3)18(25-4)10-13(12)14/h5-6,9-10,14-15,22H,7-8H2,1-4H3 |
| InChI Key | LRUYSFLNJRGVCZ-UHFFFAOYSA-N |
| Popularity | 8 references in papers |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.16270821 g/mol |
| Topological Polar Surface Area (TPSA) | 51.20 Ų |
| XlogP | 2.90 |
| NoName_1401 |
| DTXSID50902181 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.06% | 96.09% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 97.79% | 89.62% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.86% | 98.95% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 92.21% | 95.62% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 91.08% | 91.79% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.07% | 95.89% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.48% | 86.33% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.80% | 93.99% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.51% | 99.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.30% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 87.90% | 91.49% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.02% | 95.89% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.74% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.61% | 85.14% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.91% | 90.71% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.86% | 90.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.80% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Argemone polyanthemos |
| Thalictrum revolutum |
| PubChem | 12314368 |
| LOTUS | LTS0190284 |
| wikiData | Q104398712 |