Plakoridine A
Internal ID | 6923722d-febb-4aa1-85d6-ceaf81a3e79b |
Taxonomy | Benzenoids > Benzene and substituted derivatives > Phenethylamines |
IUPAC Name | methyl (2S,3S,4R,5E)-4-hydroxy-1-[2-(4-hydroxyphenyl)ethyl]-5-(2-oxooctadecylidene)-2-propylpyrrolidine-3-carboxylate |
SMILES (Canonical) | CCCCCCCCCCCCCCCCC(=O)C=C1C(C(C(N1CCC2=CC=C(C=C2)O)CCC)C(=O)OC)O |
SMILES (Isomeric) | CCCCCCCCCCCCCCCCC(=O)/C=C/1\[C@@H]([C@H]([C@@H](N1CCC2=CC=C(C=C2)O)CCC)C(=O)OC)O |
InChI | InChI=1S/C35H57NO5/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-20-30(38)27-32-34(39)33(35(40)41-3)31(19-5-2)36(32)26-25-28-21-23-29(37)24-22-28/h21-24,27,31,33-34,37,39H,4-20,25-26H2,1-3H3/b32-27+/t31-,33-,34-/m0/s1 |
InChI Key | ULFKEEJTLUNSEY-CWJJWNJISA-N |
Popularity | 0 references in papers |
Molecular Formula | C35H57NO5 |
Molecular Weight | 571.80 g/mol |
Exact Mass | 571.42367392 g/mol |
Topological Polar Surface Area (TPSA) | 87.10 Ų |
XlogP | 10.40 |
SCHEMBL21996495 |
DTXSID601031468 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.42% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.96% | 96.09% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 98.83% | 95.17% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 98.10% | 99.17% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 91.28% | 92.08% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.20% | 91.11% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 91.10% | 100.00% |
CHEMBL240 | Q12809 | HERG | 90.61% | 89.76% |
CHEMBL3891 | P07384 | Calpain 1 | 90.05% | 93.04% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.54% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.20% | 95.56% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 87.03% | 96.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.80% | 86.33% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.05% | 90.71% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.68% | 95.89% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 81.39% | 94.00% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 81.26% | 97.29% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.11% | 97.21% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.01% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Broussonetia kazinoki |
Salvia divinorum |
PubChem | 10257462 |
LOTUS | LTS0098903 |
wikiData | Q104399397 |