Plagionicin B
Internal ID | c08c05ac-b4b7-4d24-ac26-292b44117151 |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohols > Annonaceous acetogenins |
IUPAC Name | (2S)-4-[(13S)-3,13-dihydroxy-13-[(2S,5R)-5-[(1R)-1-hydroxytridecyl]oxolan-2-yl]-8-oxotridecyl]-2-methyl-2H-furan-5-one |
SMILES (Canonical) | CCCCCCCCCCCCC(C1CCC(O1)C(CCCCC(=O)CCCCC(CCC2=CC(OC2=O)C)O)O)O |
SMILES (Isomeric) | CCCCCCCCCCCC[C@H]([C@H]1CC[C@H](O1)[C@H](CCCCC(=O)CCCCC(CCC2=C[C@@H](OC2=O)C)O)O)O |
InChI | InChI=1S/C35H62O7/c1-3-4-5-6-7-8-9-10-11-12-20-31(38)33-24-25-34(42-33)32(39)21-16-15-18-29(36)17-13-14-19-30(37)23-22-28-26-27(2)41-35(28)40/h26-27,30-34,37-39H,3-25H2,1-2H3/t27-,30?,31+,32-,33+,34-/m0/s1 |
InChI Key | KCAXYJVUOXXZQC-CLIYLURBSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C35H62O7 |
Molecular Weight | 594.90 g/mol |
Exact Mass | 594.44955431 g/mol |
Topological Polar Surface Area (TPSA) | 113.00 Ų |
XlogP | 7.70 |
CHEMBL504881 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 97.75% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.96% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.89% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.83% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.76% | 99.17% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 89.34% | 85.94% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.15% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.13% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.55% | 97.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.07% | 99.23% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.07% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.79% | 86.33% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.75% | 93.56% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.37% | 92.50% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.00% | 100.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.65% | 100.00% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 80.71% | 95.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Disepalum plagioneurum |
PubChem | 44583893 |
LOTUS | LTS0023169 |
wikiData | Q105138652 |