Pipertipine
Internal ID | eca07521-5b2e-4cf2-9590-d76d2e2e237b |
Taxonomy | Organoheterocyclic compounds > Benzodioxoles |
IUPAC Name | (E)-8-(1,3-benzodioxol-5-yl)-1-piperidin-1-yloct-7-en-1-one |
SMILES (Canonical) | C1CCN(CC1)C(=O)CCCCCC=CC2=CC3=C(C=C2)OCO3 |
SMILES (Isomeric) | C1CCN(CC1)C(=O)CCCCC/C=C/C2=CC3=C(C=C2)OCO3 |
InChI | InChI=1S/C20H27NO3/c22-20(21-13-7-4-8-14-21)10-6-3-1-2-5-9-17-11-12-18-19(15-17)24-16-23-18/h5,9,11-12,15H,1-4,6-8,10,13-14,16H2/b9-5+ |
InChI Key | VIQYOKDVSJLKNG-WEVVVXLNSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H27NO3 |
Molecular Weight | 329.40 g/mol |
Exact Mass | 329.19909372 g/mol |
Topological Polar Surface Area (TPSA) | 38.80 Ų |
XlogP | 4.40 |
SCHEMBL23728189 |
CHEBI:174440 |
1-[8-(3,4-Methylenedioxyphenyl)-7-octadecenoyl]piperidine |
(E)-8-(1,3-benzodioxol-5-yl)-1-piperidin-1-yloct-7-en-1-one |
1-[8-(1,3-Benzodioxol-5-yl)-1-oxo-7-octadecenyl]piperidine, 9CI |
(7E)-8-(2H-1,3-benzodioxol-5-yl)-1-(piperidin-1-yl)oct-7-en-1-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 96.10% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.57% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.15% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.30% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.06% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.02% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.73% | 99.17% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 91.96% | 96.77% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 91.71% | 90.24% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.75% | 93.99% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.53% | 95.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.78% | 90.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.75% | 89.00% |
CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 87.20% | 96.25% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.14% | 90.00% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 84.78% | 86.00% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 83.71% | 94.80% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.47% | 95.89% |
CHEMBL5028 | O14672 | ADAM10 | 80.38% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Piper nigrum |
PubChem | 11110295 |
LOTUS | LTS0260205 |
wikiData | Q76416658 |