Phytochelatin 3
| Internal ID | 4b64ecc9-c6c9-47c3-97d8-9ac3c57eda83 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | (2S)-2-amino-5-[[(2R)-1-[[(1S)-1-carboxy-4-[[(2R)-1-[[(1S)-1-carboxy-4-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-4-oxobutyl]amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-4-oxobutyl]amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES (Canonical) | C(CC(=O)NC(CS)C(=O)NC(CCC(=O)NC(CS)C(=O)NC(CCC(=O)NC(CS)C(=O)NCC(=O)O)C(=O)O)C(=O)O)C(C(=O)O)N |
| SMILES (Isomeric) | C(CC(=O)N[C@@H](CS)C(=O)N[C@@H](CCC(=O)N[C@@H](CS)C(=O)N[C@@H](CCC(=O)N[C@@H](CS)C(=O)NCC(=O)O)C(=O)O)C(=O)O)[C@@H](C(=O)O)N |
| InChI | InChI=1S/C26H41N7O14S3/c27-11(24(42)43)1-4-17(34)30-15(9-49)22(40)32-13(26(46)47)3-6-19(36)31-16(10-50)23(41)33-12(25(44)45)2-5-18(35)29-14(8-48)21(39)28-7-20(37)38/h11-16,48-50H,1-10,27H2,(H,28,39)(H,29,35)(H,30,34)(H,31,36)(H,32,40)(H,33,41)(H,37,38)(H,42,43)(H,44,45)(H,46,47)/t11-,12-,13-,14-,15-,16-/m0/s1 |
| InChI Key | PCOMFCPXXQONPD-QNILMXGZSA-N |
| Popularity | 12 references in papers |
| Molecular Formula | C26H41N7O14S3 |
| Molecular Weight | 771.80 g/mol |
| Exact Mass | 771.18736253 g/mol |
| Topological Polar Surface Area (TPSA) | 353.00 Ų |
| XlogP | -6.70 |
| Cadystin A |
| Cadystin Protein, S Pombe |
| 86220-45-3 |
| Cadystin A (reduced) |
| (gamma-Glu-Cys)3-Gly |
| H-(gamma-Glu-Cys)3-Gly-OH |
| gammaGlu-Cys-gammaGlu-Cys-gammaGlu-Cys-Gly |
| (2S)-2-amino-5-[[(2R)-1-[[(1S)-1-carboxy-4-[[(2R)-1-[[(1S)-1-carboxy-4-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-4-oxobutyl]amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-4-oxobutyl]amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
| H-gamma-L-Glu-L-Cys-gamma-L-Glu-L-Cys-gamma-L-Glu-L-Cys-Gly-OH |
| L-gamma-glutamyl-L-cysteinyl-L-gamma-glutamyl-L-cysteinyl-L-gamma-glutamyl-L-cysteinylglycine |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.40% | 83.82% |
| CHEMBL236 | P41143 | Delta opioid receptor | 98.74% | 99.35% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.18% | 98.95% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.32% | 90.17% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.29% | 99.17% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 94.99% | 92.29% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 92.93% | 90.20% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.14% | 94.45% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 90.09% | 100.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.98% | 91.11% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 87.77% | 97.21% |
| CHEMBL3234 | P08631 | Tyrosine-protein kinase HCK | 87.60% | 88.89% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.96% | 96.09% |
| CHEMBL3784 | Q09472 | Histone acetyltransferase p300 | 86.75% | 93.33% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.62% | 91.19% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.99% | 96.95% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 85.18% | 89.63% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 84.80% | 97.23% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 84.79% | 82.86% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 84.44% | 96.28% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 84.13% | 100.00% |
| CHEMBL4801 | P29466 | Caspase-1 | 83.51% | 96.85% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.65% | 93.56% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.60% | 96.47% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 82.47% | 89.50% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 82.01% | 98.33% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.27% | 90.71% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 80.89% | 98.24% |
| CHEMBL2973 | O75116 | Rho-associated protein kinase 2 | 80.87% | 96.73% |
| CHEMBL233 | P35372 | Mu opioid receptor | 80.73% | 97.93% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 80.51% | 96.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 174541 |
| LOTUS | LTS0208838 |
| wikiData | Q27133399 |