Physapruin A
Internal ID | 227aa006-343b-4b65-bff9-d068436818c4 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones > Withanolides and derivatives |
IUPAC Name | (2R)-2-[(1S)-1-hydroxy-1-[(4S,8R,9S,10R,13S,14R,17S)-4,14,17-trihydroxy-10,13-dimethyl-1-oxo-4,7,8,9,11,12,15,16-octahydrocyclopenta[a]phenanthren-17-yl]ethyl]-4,5-dimethyl-2,3-dihydropyran-6-one |
SMILES (Canonical) | CC1=C(C(=O)OC(C1)C(C)(C2(CCC3(C2(CCC4C3CC=C5C4(C(=O)C=CC5O)C)C)O)O)O)C |
SMILES (Isomeric) | CC1=C(C(=O)O[C@H](C1)[C@@](C)([C@@]2(CC[C@@]3([C@@]2(CC[C@H]4[C@H]3CC=C5[C@@]4(C(=O)C=C[C@@H]5O)C)C)O)O)O)C |
InChI | InChI=1S/C28H38O7/c1-15-14-22(35-23(31)16(15)2)26(5,32)28(34)13-12-27(33)18-6-7-19-20(29)8-9-21(30)25(19,4)17(18)10-11-24(27,28)3/h7-9,17-18,20,22,29,32-34H,6,10-14H2,1-5H3/t17-,18+,20-,22+,24-,25+,26-,27+,28-/m0/s1 |
InChI Key | WDHSBASYULCSAT-INQWNKEXSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C28H38O7 |
Molecular Weight | 486.60 g/mol |
Exact Mass | 486.26175355 g/mol |
Topological Polar Surface Area (TPSA) | 124.00 Ų |
XlogP | 1.30 |
155178-03-3 |
(2R)-2-[(1S)-1-hydroxy-1-[(4S,8R,9S,10R,13S,14R,17S)-4,14,17-trihydroxy-10,13-dimethyl-1-oxo-4,7,8,9,11,12,15,16-octahydrocyclopenta[a]phenanthren-17-yl]ethyl]-4,5-dimethyl-2,3-dihydropyran-6-one |
CHEMBL4208456 |
HY-N8870 |
AKOS040762192 |
CS-0149278 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.20% | 97.25% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.80% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.35% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.12% | 85.14% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.07% | 100.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.64% | 97.14% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.78% | 93.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.93% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.77% | 86.33% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 85.33% | 93.04% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.17% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.05% | 94.73% |
CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 83.24% | 90.93% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.88% | 99.23% |
CHEMBL1871 | P10275 | Androgen Receptor | 82.28% | 96.43% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.61% | 96.09% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.60% | 93.03% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.10% | 97.09% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.42% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Physalis peruviana |
Physalis viscosa |
PubChem | 21607598 |
LOTUS | LTS0100108 |
wikiData | Q105302372 |