Physalolactone B
Internal ID | 639ca42e-5557-42d2-8b7e-3ba1dacfad77 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones > Withanolides and derivatives |
IUPAC Name | [17-[1-(4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl)-1-hydroxyethyl]-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-yl] acetate |
SMILES (Canonical) | CC1=C(C(=O)OC(C1)C(C)(C2CCC3C2(CCC4C3CC=C5C4(C(CC(C5)O)OC(=O)C)C)C)O)C |
SMILES (Isomeric) | CC1=C(C(=O)OC(C1)C(C)(C2CCC3C2(CCC4C3CC=C5C4(C(CC(C5)O)OC(=O)C)C)C)O)C |
InChI | InChI=1S/C30H44O6/c1-16-13-26(36-27(33)17(16)2)30(6,34)24-10-9-22-21-8-7-19-14-20(32)15-25(35-18(3)31)29(19,5)23(21)11-12-28(22,24)4/h7,20-26,32,34H,8-15H2,1-6H3 |
InChI Key | ANGCIHCSPJLGME-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C30H44O6 |
Molecular Weight | 500.70 g/mol |
Exact Mass | 500.31378912 g/mol |
Topological Polar Surface Area (TPSA) | 93.10 Ų |
XlogP | 4.60 |
14-[1-(4,5-dimethyl-6-oxo-3,6-dihydro-2H-pyran-2-yl)-1-hydroxyethyl]-5-hydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadec-7-en-3-yl acetate |
CHEBI:168104 |
LMST01160013 |
[17-[1-(4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl)-1-hydroxyethyl]-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-yl] acetate |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.16% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.64% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.61% | 97.25% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.73% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.54% | 89.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.85% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.70% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.88% | 97.09% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.42% | 95.89% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.50% | 97.14% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 86.66% | 93.04% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.63% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.09% | 94.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.85% | 93.56% |
CHEMBL5028 | O14672 | ADAM10 | 84.53% | 97.50% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.35% | 99.23% |
CHEMBL1871 | P10275 | Androgen Receptor | 83.85% | 96.43% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.17% | 94.73% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.59% | 96.95% |
CHEMBL2581 | P07339 | Cathepsin D | 80.31% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Eriolarynx australis |
Physalis peruviana |
PubChem | 53462649 |
LOTUS | LTS0083958 |
wikiData | Q104915134 |