phyllaemblicin F
Internal ID | 1019db9b-9267-4e37-82fa-9e0c49bcdddb |
Taxonomy | Lipids and lipid-like molecules > Saccharolipids |
IUPAC Name | [(2R,3S,4S,5R,6S)-6-[(2S,3R,4S,5S,6R)-2-[(2S,3aR,4R,4'S,5'R,6S,7aR)-4'-benzoyloxy-3a,4-dihydroxy-5'-methyl-3-oxospiro[5,6,7,7a-tetrahydro-4H-1-benzofuran-2,2'-oxane]-6-carbonyl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (2S,3aR,4R,4'S,5'R,6S,7aR)-4'-benzoyloxy-3a,4-dihydroxy-5'-methyl-3-oxospiro[5,6,7,7a-tetrahydro-4H-1-benzofuran-2,2'-oxane]-6-carboxylate |
SMILES (Canonical) | CC1COC2(CC1OC(=O)C3=CC=CC=C3)C(=O)C4(C(CC(CC4O2)C(=O)OCC5C(C(C(C(O5)OC6C(C(C(OC6OC(=O)C7CC(C8(C(C7)OC9(C8=O)CC(C(CO9)C)OC(=O)C1=CC=CC=C1)O)O)CO)O)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@@H]1CO[C@]2(C[C@@H]1OC(=O)C3=CC=CC=C3)C(=O)[C@]4([C@@H](C[C@@H](C[C@H]4O2)C(=O)OC[C@@H]5[C@H]([C@@H]([C@H]([C@@H](O5)O[C@@H]6[C@H]([C@@H]([C@H](O[C@H]6OC(=O)[C@H]7C[C@H]([C@]8([C@@H](C7)O[C@]9(C8=O)C[C@@H]([C@@H](CO9)C)OC(=O)C1=CC=CC=C1)O)O)CO)O)O)O)O)O)O)O |
InChI | InChI=1S/C54H66O27/c1-23-20-72-51(17-29(23)74-44(64)25-9-5-3-6-10-25)49(67)53(69)33(56)13-27(15-35(53)80-51)43(63)71-22-32-38(59)39(60)41(62)47(77-32)78-42-40(61)37(58)31(19-55)76-48(42)79-46(66)28-14-34(57)54(70)36(16-28)81-52(50(54)68)18-30(24(2)21-73-52)75-45(65)26-11-7-4-8-12-26/h3-12,23-24,27-42,47-48,55-62,69-70H,13-22H2,1-2H3/t23-,24-,27+,28+,29+,30+,31-,32-,33-,34-,35-,36-,37-,38-,39+,40+,41-,42-,47+,48+,51+,52+,53-,54-/m1/s1 |
InChI Key | MTNPUJLMKDEZOP-AVGDTWJUSA-N |
Popularity | 2 references in papers |
Molecular Formula | C54H66O27 |
Molecular Weight | 1147.10 g/mol |
Exact Mass | 1146.37914683 g/mol |
Topological Polar Surface Area (TPSA) | 406.00 Ų |
XlogP | -1.70 |
CHEMBL425214 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 98.06% | 96.61% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.66% | 91.11% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.21% | 90.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.75% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 95.64% | 98.95% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 95.51% | 94.23% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.22% | 96.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.94% | 91.49% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.09% | 95.56% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 89.72% | 94.08% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.32% | 95.50% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.24% | 97.09% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 89.13% | 83.00% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 88.65% | 94.62% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.76% | 85.14% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.23% | 97.25% |
CHEMBL5028 | O14672 | ADAM10 | 85.88% | 97.50% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.87% | 96.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.02% | 91.19% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.87% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Phyllanthus emblica |
PubChem | 45270495 |
LOTUS | LTS0090296 |
wikiData | Q105171790 |