Phygrine
| Internal ID | 752b6a39-d60b-43df-9e80-39730872458c |
| Taxonomy | Alkaloids and derivatives |
| IUPAC Name | 1-[1-methyl-5-(2-oxopropyl)pyrrolidin-2-yl]-3-(1-methylpyrrolidin-2-yl)propan-2-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H28N2O2/c1-12(19)9-14-6-7-15(18(14)3)11-16(20)10-13-5-4-8-17(13)2/h13-15H,4-11H2,1-3H3 |
| InChI Key | UBFAEXSSMSJTQV-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.215078140 g/mol |
| Topological Polar Surface Area (TPSA) | 40.60 Ų |
| XlogP | 0.70 |
| DTXSID501129800 |
| 148139-97-3 |
| 1-[1-Methyl-5-(2-oxopropyl)-2-pyrrolidinyl]-3-(1-methyl-2-pyrrolidinyl)-2-propanone |
| 1-[1-methyl-5-(2-oxopropyl)pyrrolidin-2-yl]-3-(1-methylpyrrolidin-2-yl)propan-2-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.55% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.60% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.86% | 98.95% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 87.74% | 99.18% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.23% | 96.47% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 85.59% | 98.33% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 83.60% | 93.04% |
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 82.67% | 98.46% |
| CHEMBL4072 | P07858 | Cathepsin B | 82.32% | 93.67% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.30% | 95.89% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.56% | 85.14% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 81.03% | 98.75% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 80.88% | 96.03% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 80.59% | 83.82% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.35% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Physalis angulata |
| PubChem | 10265686 |
| LOTUS | LTS0207899 |
| wikiData | Q104402016 |