Phoyunbene D
Internal ID | a80affce-4087-4d9e-940e-83b2acad6ef7 |
Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
IUPAC Name | 3-[(E)-2-(2,3-dimethoxyphenyl)ethenyl]-5-methoxyphenol |
SMILES (Canonical) | COC1=CC=CC(=C1OC)C=CC2=CC(=CC(=C2)OC)O |
SMILES (Isomeric) | COC1=CC=CC(=C1OC)/C=C/C2=CC(=CC(=C2)OC)O |
InChI | InChI=1S/C17H18O4/c1-19-15-10-12(9-14(18)11-15)7-8-13-5-4-6-16(20-2)17(13)21-3/h4-11,18H,1-3H3/b8-7+ |
InChI Key | JTNSCGPJCOQOIF-BQYQJAHWSA-N |
Popularity | 2 references in papers |
Molecular Formula | C17H18O4 |
Molecular Weight | 286.32 g/mol |
Exact Mass | 286.12050905 g/mol |
Topological Polar Surface Area (TPSA) | 47.90 Ų |
XlogP | 3.80 |
CHEBI:66756 |
3-[(E)-2-(2,3-dimethoxyphenyl)ethenyl]-5-methoxyphenol |
CHEMBL2012419 |
trans-3-Hydroxy-2',3',5-trimethoxystilbene |
Q27135382 |
![2D Structure of Phoyunbene D 2D Structure of Phoyunbene D](https://plantaedb.com/storage/docs/compounds/2023/11/phoyunbene-d.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.60% | 95.56% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.30% | 96.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.80% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.90% | 86.33% |
CHEMBL2535 | P11166 | Glucose transporter | 92.46% | 98.75% |
CHEMBL2581 | P07339 | Cathepsin D | 88.50% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.02% | 96.09% |
CHEMBL3194 | P02766 | Transthyretin | 87.43% | 90.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.83% | 99.17% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 85.68% | 100.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.51% | 99.15% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.63% | 91.71% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.18% | 89.62% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.78% | 94.73% |
CHEMBL1907599 | P05556 | Integrin alpha-4/beta-1 | 80.62% | 92.86% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.51% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Pholidota chinensis |
Pholidota yunnanensis |
PubChem | 11601663 |
LOTUS | LTS0060795 |
wikiData | Q27135382 |