Phosphatidylethanolamine
Internal ID | 83f04c9f-41e5-4971-90aa-446fd4e26781 |
Taxonomy | Lipids and lipid-like molecules > Glycerophospholipids > Glycerophosphoethanolamines > Phosphatidylethanolamines |
IUPAC Name | [(2R)-2-acetyloxy-3-[2-aminoethoxy(hydroxy)phosphoryl]oxypropyl] acetate |
SMILES (Canonical) | CC(=O)OCC(COP(=O)(O)OCCN)OC(=O)C |
SMILES (Isomeric) | CC(=O)OC[C@H](COP(=O)(O)OCCN)OC(=O)C |
InChI | InChI=1S/C9H18NO8P/c1-7(11)15-5-9(18-8(2)12)6-17-19(13,14)16-4-3-10/h9H,3-6,10H2,1-2H3,(H,13,14)/t9-/m1/s1 |
InChI Key | CFWRDBDJAOHXSH-SECBINFHSA-N |
Popularity | 13,238 references in papers |
Molecular Formula | C9H18NO8P |
Molecular Weight | 299.21 g/mol |
Exact Mass | 299.07700353 g/mol |
Topological Polar Surface Area (TPSA) | 134.00 Ų |
XlogP | -4.40 |
1334474-30-4 |
7CMB6B4449 |
Phosphatidylethanolamine [USP-RS] |
Phosphatidylethanolamine [WHO-DD] |
UNII-7CMB6B4449 |
[(2R)-2-acetyloxy-3-[2-aminoethoxy(hydroxy)phosphoryl]oxypropyl] acetate |
Phosphoric acid, mono(2-aminoethyl) mono((2R)-2,3-bis(acetyloxy)propyl) ester |
SCHEMBL5959467 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.56% | 96.09% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 97.42% | 95.17% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 93.89% | 97.29% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 90.07% | 83.82% |
CHEMBL3230 | O95977 | Sphingosine 1-phosphate receptor Edg-6 | 89.77% | 94.01% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 87.54% | 96.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.85% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.19% | 94.45% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.12% | 94.33% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 84.29% | 87.67% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.63% | 94.73% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.17% | 97.21% |
CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 81.93% | 92.95% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.46% | 96.00% |
CHEMBL2885 | P07451 | Carbonic anhydrase III | 80.39% | 87.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
There are no matching plants. |
PubChem | 5327011 |
LOTUS | LTS0070503 |
wikiData | Q76303953 |