Pholipeptin
| Internal ID | 33b6bbf2-eba8-450f-8259-9586b4653796 |
| Taxonomy | Organic Polymers > Polypeptides |
| IUPAC Name | (7S,10R,13R,16R,19R,22R,25R,28S,29R)-7-[(2S)-butan-2-yl]-28-[[3-carboxy-2-[[(2R)-2-(3-hydroxydecanoylamino)-4-methylpentanoyl]amino]propanoyl]amino]-13,19-bis(hydroxymethyl)-29-methyl-10,16,22,25-tetrakis(2-methylpropyl)-2,6,9,12,15,18,21,24,27-nonaoxo-1-oxa-5,8,11,14,17,20,23,26-octazacyclononacosane-4-carboxylic acid |
| SMILES (Canonical) | CCCCCCCC(CC(=O)NC(CC(C)C)C(=O)NC(CC(=O)O)C(=O)NC1C(OC(=O)CC(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC1=O)CC(C)C)CC(C)C)CO)CC(C)C)CO)CC(C)C)C(C)CC)C(=O)O)C)O |
| SMILES (Isomeric) | CCCCCCCC(CC(=O)N[C@H](CC(C)C)C(=O)NC(CC(=O)O)C(=O)N[C@H]1[C@H](OC(=O)CC(NC(=O)[C@@H](NC(=O)[C@H](NC(=O)[C@H](NC(=O)[C@H](NC(=O)[C@H](NC(=O)[C@H](NC(=O)[C@H](NC1=O)CC(C)C)CC(C)C)CO)CC(C)C)CO)CC(C)C)[C@@H](C)CC)C(=O)O)C)O |
| InChI | InChI=1S/C64H111N11O20/c1-15-17-18-19-20-21-39(78)27-49(79)65-40(22-32(3)4)54(83)69-45(28-50(80)81)59(88)75-53-38(14)95-51(82)29-46(64(93)94)71-62(91)52(37(13)16-2)74-58(87)44(26-36(11)12)68-61(90)48(31-77)73-57(86)42(24-34(7)8)67-60(89)47(30-76)72-56(85)41(23-33(5)6)66-55(84)43(25-35(9)10)70-63(53)92/h32-48,52-53,76-78H,15-31H2,1-14H3,(H,65,79)(H,66,84)(H,67,89)(H,68,90)(H,69,83)(H,70,92)(H,71,91)(H,72,85)(H,73,86)(H,74,87)(H,75,88)(H,80,81)(H,93,94)/t37-,38+,39?,40+,41+,42+,43+,44+,45?,46?,47+,48+,52-,53-/m0/s1 |
| InChI Key | FIDWFJZZQLPPLI-FRYCLEKBSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C64H111N11O20 |
| Molecular Weight | 1354.60 g/mol |
| Exact Mass | 1353.80068497 g/mol |
| Topological Polar Surface Area (TPSA) | 482.00 Ų |
| XlogP | 5.10 |
| Atomic LogP (AlogP) | -0.41 |
| H-Bond Acceptor | 18 |
| H-Bond Donor | 16 |
| Rotatable Bonds | 30 |
| (7S,10R,13R,16R,19R,22R,25R,28S,29R)-7-[(2S)-butan-2-yl]-28-[[3-carboxy-2-[[(2R)-2-(3-hydroxydecanoylamino)-4-methylpentanoyl]amino]propanoyl]amino]-13,19-bis(hydroxymethyl)-29-methyl-10,16,22,25-tetrakis(2-methylpropyl)-2,6,9,12,15,18,21,24,27-nonaoxo-1-oxa-5,8,11,14,17,20,23,26-octazacyclononacosane-4-carboxylic acid |
| (7S,10R,13R,16R,19R,22R,25R,28S,29R)-7-((2S)-butan-2-yl)-28-((3-carboxy-2-(((2R)-2-(3-hydroxydecanoylamino)-4-methylpentanoyl)amino)propanoyl)amino)-13,19-bis(hydroxymethyl)-29-methyl-10,16,22,25-tetrakis(2-methylpropyl)-2,6,9,12,15,18,21,24,27-nonaoxo-1-oxa-5,8,11,14,17,20,23,26-octazacyclononacosane-4-carboxylic acid |
| RefChem:173212 |
| 169626-46-4 |
| (7S,10R,13R,16R,19R,22R,25R,28S,29R)-7-((2S)-Butan-2-yl)-28-((3-carboxy-2-(((2R)-2-((1,3-dihydroxydecylidene)amino)-1-hydroxy-4-methylpentylidene)amino)-1-hydroxypropylidene)amino)-6,9,12,15,18,21,24,27-octahydroxy-13,19-bis(hydroxymethyl)-29-methyl-10,16,22,25-tetrakis(2-methylpropyl)-2-oxo-1-oxa-5,8,11,14,17,20,23,26-octaazacyclononacosa-5,8,11,14,17,20,23,26-octaene-4-carboxylate |
| (7S,10R,13R,16R,19R,22R,25R,28S,29R)-7-[(2S)-Butan-2-yl]-28-[(3-carboxy-2-{[(2R)-2-[(1,3-dihydroxydecylidene)amino]-1-hydroxy-4-methylpentylidene]amino}-1-hydroxypropylidene)amino]-6,9,12,15,18,21,24,27-octahydroxy-13,19-bis(hydroxymethyl)-29-methyl-10,16,22,25-tetrakis(2-methylpropyl)-2-oxo-1-oxa-5,8,11,14,17,20,23,26-octaazacyclononacosa-5,8,11,14,17,20,23,26-octaene-4-carboxylate |
| SCHEMBL29773731 |
| CHEBI:204572 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.5058 | 50.58% |
| Caco-2 | - | 0.8593 | 85.93% |
| Blood Brain Barrier | - | 0.8750 | 87.50% |
| Human oral bioavailability | - | 0.7286 | 72.86% |
| Subcellular localzation | Mitochondria | 0.5577 | 55.77% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8262 | 82.62% |
| OATP1B3 inhibitior | + | 0.8899 | 88.99% |
| MATE1 inhibitior | - | 0.9600 | 96.00% |
| OCT2 inhibitior | - | 0.9750 | 97.50% |
| BSEP inhibitior | + | 0.9544 | 95.44% |
| P-glycoprotein inhibitior | + | 0.7411 | 74.11% |
| P-glycoprotein substrate | + | 0.8831 | 88.31% |
| CYP3A4 substrate | + | 0.7052 | 70.52% |
| CYP2C9 substrate | - | 0.6062 | 60.62% |
| CYP2D6 substrate | - | 0.8665 | 86.65% |
| CYP3A4 inhibition | - | 0.6690 | 66.90% |
| CYP2C9 inhibition | - | 0.9408 | 94.08% |
| CYP2C19 inhibition | - | 0.9364 | 93.64% |
| CYP2D6 inhibition | - | 0.9278 | 92.78% |
| CYP1A2 inhibition | - | 0.9435 | 94.35% |
| CYP2C8 inhibition | + | 0.6112 | 61.12% |
| CYP inhibitory promiscuity | - | 0.9871 | 98.71% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.8400 | 84.00% |
| Carcinogenicity (trinary) | Non-required | 0.6344 | 63.44% |
| Eye corrosion | - | 0.9860 | 98.60% |
| Eye irritation | - | 0.8958 | 89.58% |
| Skin irritation | - | 0.7894 | 78.94% |
| Skin corrosion | - | 0.9398 | 93.98% |
| Ames mutagenesis | - | 0.7900 | 79.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6928 | 69.28% |
| Micronuclear | + | 0.7600 | 76.00% |
| Hepatotoxicity | + | 0.5273 | 52.73% |
| skin sensitisation | - | 0.8786 | 87.86% |
| Respiratory toxicity | + | 0.7222 | 72.22% |
| Reproductive toxicity | + | 0.7222 | 72.22% |
| Mitochondrial toxicity | + | 0.7625 | 76.25% |
| Nephrotoxicity | + | 0.7203 | 72.03% |
| Acute Oral Toxicity (c) | III | 0.6979 | 69.79% |
| Estrogen receptor binding | + | 0.6976 | 69.76% |
| Androgen receptor binding | + | 0.6887 | 68.87% |
| Thyroid receptor binding | + | 0.5396 | 53.96% |
| Glucocorticoid receptor binding | + | 0.6731 | 67.31% |
| Aromatase binding | + | 0.7007 | 70.07% |
| PPAR gamma | + | 0.7604 | 76.04% |
| Honey bee toxicity | - | 0.7571 | 75.71% |
| Biodegradation | - | 0.7500 | 75.00% |
| Crustacea aquatic toxicity | + | 0.5524 | 55.24% |
| Fish aquatic toxicity | - | 0.4210 | 42.10% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.90% | 98.95% |
| CHEMBL3837 | P07711 | Cathepsin L | 99.71% | 96.61% |
| CHEMBL4801 | P29466 | Caspase-1 | 99.35% | 96.85% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 98.12% | 93.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 98.04% | 99.17% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 97.34% | 90.24% |
| CHEMBL3776 | Q14790 | Caspase-8 | 96.10% | 97.06% |
| CHEMBL236 | P41143 | Delta opioid receptor | 96.01% | 99.35% |
| CHEMBL3468 | P55210 | Caspase-7 | 95.99% | 95.68% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.83% | 90.17% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 95.57% | 98.05% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.34% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.54% | 91.11% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 94.45% | 98.10% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 94.44% | 92.08% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 94.21% | 90.71% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 92.69% | 96.90% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 91.57% | 92.29% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 91.57% | 90.08% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 91.36% | 90.93% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 91.09% | 98.03% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.89% | 96.47% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 90.69% | 89.50% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 90.24% | 91.81% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 89.97% | 97.64% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.93% | 97.09% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 89.72% | 97.14% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 89.62% | 94.66% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 89.56% | 97.29% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 89.08% | 97.23% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 89.04% | 100.00% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 88.91% | 96.00% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 88.85% | 96.11% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.75% | 99.23% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.64% | 93.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.34% | 94.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.31% | 95.56% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 85.26% | 95.00% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 85.15% | 97.79% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 84.70% | 89.63% |
| CHEMBL2334 | P42574 | Caspase-3 | 84.36% | 98.25% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.62% | 95.50% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.35% | 91.19% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 83.33% | 97.50% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 83.09% | 90.20% |
| CHEMBL1801 | P00747 | Plasminogen | 82.79% | 92.44% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.25% | 89.00% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 81.78% | 94.80% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.48% | 92.50% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 80.80% | 100.00% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 80.35% | 92.32% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10725143 |
| LOTUS | LTS0185853 |
| wikiData | Q77386710 |