Phochinenin G
Internal ID | 9af3c83a-b00a-4fdc-b5b4-919a211b224f |
Taxonomy | Lignans, neolignans and related compounds |
IUPAC Name | 3-(4,7-dihydroxy-2-methoxy-9,10-dihydrophenanthren-3-yl)-7-methoxy-9,10-dihydrophenanthrene-2,5-diol |
SMILES (Canonical) | COC1=CC2=C(C3=CC(=C(C=C3CC2)O)C4=C(C=C5CCC6=C(C5=C4O)C=CC(=C6)O)OC)C(=C1)O |
SMILES (Isomeric) | COC1=CC2=C(C3=CC(=C(C=C3CC2)O)C4=C(C=C5CCC6=C(C5=C4O)C=CC(=C6)O)OC)C(=C1)O |
InChI | InChI=1S/C30H26O6/c1-35-20-10-17-5-4-16-11-24(32)23(14-22(16)27(17)25(33)13-20)29-26(36-2)12-18-6-3-15-9-19(31)7-8-21(15)28(18)30(29)34/h7-14,31-34H,3-6H2,1-2H3 |
InChI Key | FRNODSBMQDXGBL-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C30H26O6 |
Molecular Weight | 482.50 g/mol |
Exact Mass | 482.17293854 g/mol |
Topological Polar Surface Area (TPSA) | 99.40 Ų |
XlogP | 5.90 |
CHEMBL3965220 |
AKOS040762893 |
1070883-75-8 |
![2D Structure of Phochinenin G 2D Structure of Phochinenin G](https://plantaedb.com/storage/docs/compounds/2023/11/phochinenin-g.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.49% | 91.11% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 96.52% | 91.79% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.17% | 91.49% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 95.52% | 98.35% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.25% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.24% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 93.84% | 90.00% |
CHEMBL2581 | P07339 | Cathepsin D | 92.49% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.43% | 86.33% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 89.92% | 91.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.66% | 99.15% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.43% | 94.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.69% | 95.89% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 87.27% | 82.67% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.17% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.53% | 99.17% |
CHEMBL2535 | P11166 | Glucose transporter | 83.15% | 98.75% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.45% | 92.94% |
CHEMBL3194 | P02766 | Transthyretin | 81.35% | 90.71% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.19% | 89.62% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 80.32% | 92.68% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.05% | 93.99% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Pholidota chinensis |
PubChem | 102477413 |
LOTUS | LTS0209523 |
wikiData | Q105000316 |