Phloretin 3',5'-Di-C-glucoside
Internal ID | 2a62e5a9-4711-4aa3-86d1-aaa346229f33 |
Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Chalcones and dihydrochalcones > 2-Hydroxy-dihydrochalcones |
IUPAC Name | 3-(4-hydroxyphenyl)-1-[2,4,6-trihydroxy-3,5-bis[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]propan-1-one |
SMILES (Canonical) | C1=CC(=CC=C1CCC(=O)C2=C(C(=C(C(=C2O)C3C(C(C(C(O3)CO)O)O)O)O)C4C(C(C(C(O4)CO)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1CCC(=O)C2=C(C(=C(C(=C2O)[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O)[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O)O |
InChI | InChI=1S/C27H34O15/c28-7-12-17(32)22(37)24(39)26(41-12)15-19(34)14(11(31)6-3-9-1-4-10(30)5-2-9)20(35)16(21(15)36)27-25(40)23(38)18(33)13(8-29)42-27/h1-2,4-5,12-13,17-18,22-30,32-40H,3,6-8H2/t12-,13-,17-,18-,22+,23+,24-,25-,26+,27+/m1/s1 |
InChI Key | WAWHTTXPRUWFCZ-DBGLWBBTSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C27H34O15 |
Molecular Weight | 598.50 g/mol |
Exact Mass | 598.18977037 g/mol |
Topological Polar Surface Area (TPSA) | 278.00 Ų |
XlogP | -2.30 |
3',5'-di-C-glucosylphloretin |
357401-40-2 |
MEGxp0_001019 |
ACon1_001169 |
CHEBI:139415 |
AKOS040735010 |
FS-8390 |
NCGC00169611-01 |
BRD-K87036325-001-01-1 |
3-(4-Hydroxyphenyl)-1-[2,4,6-trihydroxy-3,5-bis[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]propan-1-one |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.48% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.12% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 94.87% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.17% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.10% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.71% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.23% | 95.56% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 82.74% | 94.62% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 82.64% | 85.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.97% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.34% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.19% | 86.33% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.02% | 97.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Citrus japonica |
Paronychia argentea |
PubChem | 10908130 |
LOTUS | LTS0218585 |
wikiData | Q76416181 |