Phlomuroside
Internal ID | 085c1cce-f003-4719-b910-6fe8a0f089c9 |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acyl glycosides > Fatty acyl glycosides of mono- and disaccharides |
IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(E,2R)-4-[(1R,4S,6S)-4-hydroxy-2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl]but-3-en-2-yl]oxyoxane-3,4,5-triol |
SMILES (Canonical) | CC(C=CC12C(CC(CC1(O2)C)O)(C)C)OC3C(C(C(C(O3)CO)O)O)O |
SMILES (Isomeric) | C[C@H](/C=C/[C@@]12[C@@](O1)(C[C@H](CC2(C)C)O)C)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O |
InChI | InChI=1S/C19H32O8/c1-10(25-16-15(24)14(23)13(22)12(9-20)26-16)5-6-19-17(2,3)7-11(21)8-18(19,4)27-19/h5-6,10-16,20-24H,7-9H2,1-4H3/b6-5+/t10-,11+,12-,13-,14+,15-,16-,18+,19-/m1/s1 |
InChI Key | RIUMIKAUMHZQMP-IQUVFKTMSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C19H32O8 |
Molecular Weight | 388.50 g/mol |
Exact Mass | 388.20971797 g/mol |
Topological Polar Surface Area (TPSA) | 132.00 Ų |
XlogP | -0.50 |
CHEBI:69851 |
CHEMBL1814430 |
Q27138190 |
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(E,2R)-4-[(1R,4S,6S)-4-hydroxy-2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl]but-3-en-2-yl]oxyoxane-3,4,5-triol |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.99% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.63% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 94.45% | 95.93% |
CHEMBL2581 | P07339 | Cathepsin D | 88.75% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.16% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.21% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.05% | 95.89% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 84.75% | 83.82% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 83.43% | 95.83% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 82.97% | 92.32% |
CHEMBL3286 | P00749 | Urokinase-type plasminogen activator | 82.11% | 97.88% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.90% | 99.17% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.31% | 85.14% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.03% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bunias orientalis |
Crotalaria trichotoma |
Hemerocallis fulva |
Phlomis aurea |
Sanicula lamelligera |
PubChem | 637144 |
LOTUS | LTS0091540 |
wikiData | Q27138190 |