Phlinoside B
Internal ID | 6eb39068-8f95-4668-b321-4b547e765b74 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
IUPAC Name | [(2R,3R,4R,5R,6R)-4-[(2S,3R,4R,5R,6S)-4,5-dihydroxy-6-methyl-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-6-[2-(3,4-dihydroxyphenyl)ethoxy]-5-hydroxy-2-(hydroxymethyl)oxan-3-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(OC(C2OC(=O)C=CC3=CC(=C(C=C3)O)O)CO)OCCC4=CC(=C(C=C4)O)O)O)OC5C(C(C(CO5)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H](O[C@@H]([C@H]2OC(=O)/C=C/C3=CC(=C(C=C3)O)O)CO)OCCC4=CC(=C(C=C4)O)O)O)O[C@H]5[C@@H]([C@H]([C@@H](CO5)O)O)O)O)O |
InChI | InChI=1S/C34H44O19/c1-14-24(42)26(44)31(53-32-27(45)25(43)21(40)13-48-32)34(49-14)52-30-28(46)33(47-9-8-16-3-6-18(37)20(39)11-16)50-22(12-35)29(30)51-23(41)7-4-15-2-5-17(36)19(38)10-15/h2-7,10-11,14,21-22,24-40,42-46H,8-9,12-13H2,1H3/b7-4+/t14-,21+,22+,24-,25-,26+,27+,28+,29+,30+,31+,32-,33+,34-/m0/s1 |
InChI Key | UDHCHDJLZGYDDM-UVQMCPPLSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C34H44O19 |
Molecular Weight | 756.70 g/mol |
Exact Mass | 756.24767917 g/mol |
Topological Polar Surface Area (TPSA) | 304.00 Ų |
XlogP | -2.00 |
129097-46-7 |
[(2R,3R,4R,5R,6R)-4-[(2S,3R,4R,5R,6S)-4,5-dihydroxy-6-methyl-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-6-[2-(3,4-dihydroxyphenyl)ethoxy]-5-hydroxy-2-(hydroxymethyl)oxan-3-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
DTXSID00904211 |
(E)-2-(3,4-Dihydroxyphenyl)ethyl O-beta-D-xylopyranosyl-(1-2)-O-6-deoxy-alpha-L-mannopyranosyl-(1-3)-beta-D-glucopyranoside 4-(3-(3,4-dihydroxyphenyl)-2-propenoate) |
3,4-Dihydroxy-beta-phenylethoxy-O-beta-xylopyranosyl-(1-2)-alpha-rhamnopyranosyl-(1-3)-4-O-caffeoyl-beta-glucopyranoside |
3,4-dihydroxy-beta phenylethoxy-O-beta-xylopyranosyl-(1-2)-alpha-rhamnopyranosyl-(1-3)-4-O-caffeoyl-beta-glucopyranoside |
beta-D-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl O-beta-D-xylopyra nosyl-(1-2)-O-6-deoxy-alpha-L |
beta-D-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl O-beta-D-xylopyranosyl-(1-2)-O-6-deoxy-alpha-L-mannopyranosyl-(1-3)-, 4-(3-(3,4-dihydroxyphenyl)-2-propenoate), (E)- |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.85% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.15% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.10% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.59% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.26% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 94.26% | 98.95% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 92.89% | 86.92% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.60% | 96.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.02% | 94.73% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 90.78% | 97.36% |
CHEMBL3194 | P02766 | Transthyretin | 90.12% | 90.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.95% | 99.17% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 88.91% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.26% | 97.09% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 84.43% | 80.78% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 84.27% | 96.37% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.13% | 90.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.15% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.94% | 95.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.08% | 90.71% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.87% | 91.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Phlomis armeniaca |
Phlomis linearis |
PubChem | 6450096 |
LOTUS | LTS0077521 |
wikiData | Q82873452 |