Phlegmarine
Internal ID | 43b6685e-8fd6-4a3c-8d4b-394822fcc1cd |
Taxonomy | Organoheterocyclic compounds > Quinolidines |
IUPAC Name | (4aR,5S,7R,8aR)-7-methyl-5-[[(2S)-piperidin-2-yl]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline |
SMILES (Canonical) | CC1CC(C2CCCNC2C1)CC3CCCCN3 |
SMILES (Isomeric) | C[C@@H]1C[C@H]([C@H]2CCCN[C@@H]2C1)C[C@@H]3CCCCN3 |
InChI | InChI=1S/C16H30N2/c1-12-9-13(11-14-5-2-3-7-17-14)15-6-4-8-18-16(15)10-12/h12-18H,2-11H2,1H3/t12-,13+,14+,15-,16-/m1/s1 |
InChI Key | HLJWSLBSLJLQBA-LYYZXLFJSA-N |
Popularity | 3 references in papers |
Molecular Formula | C16H30N2 |
Molecular Weight | 250.42 g/mol |
Exact Mass | 250.240898965 g/mol |
Topological Polar Surface Area (TPSA) | 24.10 Ų |
XlogP | 3.20 |
66834-87-5 |
(4aR,5S,7R,8aR)-7-methyl-5-[[(2S)-piperidin-2-yl]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline |
C09892 |
CHEBI:8109 |
DTXSID00331846 |
Q27107796 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.19% | 97.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 94.07% | 95.93% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.95% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.37% | 96.09% |
CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 89.54% | 90.71% |
CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 88.38% | 98.99% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 88.28% | 97.21% |
CHEMBL2916 | O14746 | Telomerase reverse transcriptase | 85.68% | 90.00% |
CHEMBL238 | Q01959 | Dopamine transporter | 84.77% | 95.88% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.81% | 95.50% |
CHEMBL237 | P41145 | Kappa opioid receptor | 83.61% | 98.10% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.33% | 96.95% |
CHEMBL228 | P31645 | Serotonin transporter | 83.09% | 95.51% |
CHEMBL3785 | Q8TDS4 | Hydroxycarboxylic acid receptor 2 | 81.97% | 94.05% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.85% | 92.94% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 81.46% | 95.58% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.96% | 93.04% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lycopodiella cernua |
PubChem | 442494 |
LOTUS | LTS0071782 |
wikiData | Q27107796 |