Phenopicolinic acid
| Internal ID | 2c7ed1e3-d987-4e25-9a69-cf57d269f307 |
| Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Pyridinecarboxylic acids and derivatives > Pyridine-2-carboxylic acids > 5-alkyl-2-carboxypyrimidines |
| IUPAC Name | 5-[(4-hydroxyphenyl)methyl]pyridine-2-carboxylic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C13H11NO3/c15-11-4-1-9(2-5-11)7-10-3-6-12(13(16)17)14-8-10/h1-6,8,15H,7H2,(H,16,17) |
| InChI Key | SJBFZHNCSGBLEK-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.07389321 g/mol |
| Topological Polar Surface Area (TPSA) | 70.40 Ų |
| XlogP | 2.30 |
| 5-(4-Hydroxybenzyl)picolinic acid |
| 56153-30-1 |
| 2-Pyridinecarboxylic acid, 5-((4-hydroxyphenyl)methyl)- |
| BQT8GD5527 |
| CHEMBL4764135 |
| 5-((4-Hydroxyphenyl)methyl)-2-pyridinecarboxylic acid |
| 5-[(4-Hydroxyphenyl)methyl]-2-pyridinecarboxylic acid |
| 2-Pyridinecarboxylic acid, 5-[(4-hydroxyphenyl)methyl]- |
| BRN 0478935 |
| UNII-BQT8GD5527 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.47% | 96.09% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 88.06% | 94.62% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.91% | 95.50% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 86.56% | 93.10% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.46% | 99.17% |
| CHEMBL1811 | P34995 | Prostanoid EP1 receptor | 86.43% | 95.71% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.82% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.70% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.79% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 3043792 |
| LOTUS | LTS0072694 |
| wikiData | Q7181395 |