Phenol, 3-(8,11,14-pentadecatrienyl)-
| Internal ID | f7cfb645-08d9-4e28-b14c-56012a5dbd5c |
| Taxonomy | Benzenoids > Phenols > 1-hydroxy-4-unsubstituted benzenoids |
| IUPAC Name | 3-pentadeca-8,11,14-trienylphenol |
| SMILES (Canonical) | C=CCC=CCC=CCCCCCCCC1=CC(=CC=C1)O |
| SMILES (Isomeric) | C=CCC=CCC=CCCCCCCCC1=CC(=CC=C1)O |
| InChI | InChI=1S/C21H30O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-20-17-15-18-21(22)19-20/h2,4-5,7-8,15,17-19,22H,1,3,6,9-14,16H2 |
| InChI Key | JOLVYUIAMRUBRK-UHFFFAOYSA-N |
| Popularity | 5 references in papers |
| Molecular Formula | C21H30O |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.229665576 g/mol |
| Topological Polar Surface Area (TPSA) | 20.20 Ų |
| XlogP | 7.60 |
| Phenol, 3-(8,11,14-pentadecatrienyl)- |
| SCHEMBL2687568 |
| DTXSID00391182 |
| 3-(n-pentadeca-8,11,14-trienyl) phenol |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.39% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.46% | 99.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.69% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.28% | 86.33% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 89.80% | 91.49% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.87% | 94.73% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.07% | 96.09% |
| CHEMBL3891 | P07384 | Calpain 1 | 86.86% | 93.04% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 86.48% | 95.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.50% | 94.45% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 85.47% | 92.08% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.86% | 95.56% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 84.57% | 96.25% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 82.93% | 93.81% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.83% | 91.71% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.98% | 95.89% |
| CHEMBL236 | P41143 | Delta opioid receptor | 81.84% | 99.35% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 81.49% | 99.18% |
| CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 80.95% | 88.00% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 80.50% | 97.00% |
| CHEMBL233 | P35372 | Mu opioid receptor | 80.42% | 97.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Anacardium occidentale |
| PubChem | 3297127 |
| LOTUS | LTS0257196 |
| wikiData | Q82188462 |