Phenol, 3-(8,11-pentadecadienyl)-
| Internal ID | 911becf2-4a5f-4647-a896-3a0cbf2de214 |
| Taxonomy | Benzenoids > Phenols > 1-hydroxy-4-unsubstituted benzenoids |
| IUPAC Name | 3-pentadeca-8,11-dienylphenol |
| SMILES (Canonical) | CCCC=CCC=CCCCCCCCC1=CC(=CC=C1)O |
| SMILES (Isomeric) | CCCC=CCC=CCCCCCCCC1=CC(=CC=C1)O |
| InChI | InChI=1S/C21H32O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-20-17-15-18-21(22)19-20/h4-5,7-8,15,17-19,22H,2-3,6,9-14,16H2,1H3 |
| InChI Key | FAYVLNWNMNHXGA-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C21H32O |
| Molecular Weight | 300.50 g/mol |
| Exact Mass | 300.245315640 g/mol |
| Topological Polar Surface Area (TPSA) | 20.20 Ų |
| XlogP | 7.80 |
| 31910-56-2 |
| SCHEMBL2689200 |
| DTXSID60287456 |
| 3-(n-pentadeca-8,11-dienyl) phenol |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.82% | 98.95% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 96.04% | 92.08% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.30% | 99.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.27% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.75% | 96.09% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 90.75% | 94.73% |
| CHEMBL240 | Q12809 | HERG | 88.20% | 89.76% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 86.19% | 91.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.45% | 95.56% |
| CHEMBL236 | P41143 | Delta opioid receptor | 85.24% | 99.35% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.74% | 91.11% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.91% | 98.75% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 83.64% | 91.49% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 83.42% | 97.00% |
| CHEMBL3891 | P07384 | Calpain 1 | 81.74% | 93.04% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 80.83% | 96.25% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.29% | 96.95% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 80.03% | 99.18% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Anacardium occidentale |
| PubChem | 242469 |
| LOTUS | LTS0133370 |
| wikiData | Q82023506 |