Phenol, 2-methoxy-6-(2-methoxy-4-(2-propenyl)phenoxy)-4-(2-propenyl)-
Internal ID | 0df3673d-f0d1-42af-a859-35d17d12e97d |
Taxonomy | Benzenoids > Benzene and substituted derivatives > Diphenylethers |
IUPAC Name | 2-methoxy-6-(2-methoxy-4-prop-2-enylphenoxy)-4-prop-2-enylphenol |
SMILES (Canonical) | COC1=C(C=CC(=C1)CC=C)OC2=CC(=CC(=C2O)OC)CC=C |
SMILES (Isomeric) | COC1=C(C=CC(=C1)CC=C)OC2=CC(=CC(=C2O)OC)CC=C |
InChI | InChI=1S/C20H22O4/c1-5-7-14-9-10-16(17(11-14)22-3)24-19-13-15(8-6-2)12-18(23-4)20(19)21/h5-6,9-13,21H,1-2,7-8H2,3-4H3 |
InChI Key | IHJFUBOOWFHEMB-UHFFFAOYSA-N |
Popularity | 8 references in papers |
Molecular Formula | C20H22O4 |
Molecular Weight | 326.40 g/mol |
Exact Mass | 326.15180918 g/mol |
Topological Polar Surface Area (TPSA) | 47.90 Ų |
XlogP | 5.20 |
Phenol, 2-methoxy-6-(2-methoxy-4-(2-propenyl)phenoxy)-4-(2-propenyl)- |
2-methoxy-6-(2-methoxy-4-prop-2-enyl-phenoxy)-4-prop-2-enyl-phenol |
2-Methoxy-6-(2-methoxy-4-(2-propenyl)phenoxy)-4-(2-propenyl)phenol |
CHEMBL3577778 |
DTXSID50226192 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.40% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.94% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.27% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 90.42% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.99% | 99.17% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 89.98% | 90.20% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 86.85% | 90.24% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.04% | 90.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.67% | 95.56% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 84.57% | 91.49% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.28% | 92.94% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.83% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.77% | 94.45% |
CHEMBL3194 | P02766 | Transthyretin | 81.38% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ocimum tenuiflorum |
Virola surinamensis |
PubChem | 154407 |
LOTUS | LTS0275694 |
wikiData | Q83105516 |