(+)-Curcuphenol
| Internal ID | 5a91de26-8987-4d04-9267-a5c45831117e |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | 5-methyl-2-[(2S)-6-methylhept-5-en-2-yl]phenol |
| SMILES (Canonical) | CC1=CC(=C(C=C1)C(C)CCC=C(C)C)O |
| SMILES (Isomeric) | CC1=CC(=C(C=C1)[C@@H](C)CCC=C(C)C)O |
| InChI | InChI=1S/C15H22O/c1-11(2)6-5-7-13(4)14-9-8-12(3)10-15(14)16/h6,8-10,13,16H,5,7H2,1-4H3/t13-/m0/s1 |
| InChI Key | BTXSROVNGICYFE-ZDUSSCGKSA-N |
| Popularity | 12 references in papers |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.33 g/mol |
| Exact Mass | 218.167065321 g/mol |
| Topological Polar Surface Area (TPSA) | 20.20 Ų |
| XlogP | 5.30 |
| (S)-(+)-Curcuphenol |
| 70878-71-6 |
| Phenol, 2-((1S)-1,5-dimethyl-4-hexenyl)-5-methyl- |
| (S)-Curcuphenol |
| (1S)-(+)-Curcuphenol |
| CHEMBL451860 |
| SCHEMBL16749882 |
| DTXSID901035469 |
| NSC750820 |
| NSC-750820 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL267 | P12931 | Tyrosine-protein kinase SRC |
35800 nM |
IC50 |
DOI: 10.1039/C2MD20185B
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 94.94% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.57% | 91.11% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 93.40% | 94.73% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.59% | 95.56% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 86.71% | 94.62% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.13% | 90.71% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.83% | 93.56% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 84.98% | 97.21% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.78% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.16% | 96.09% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 82.51% | 93.18% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 80.80% | 92.08% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 80.24% | 91.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Curcuma longa |
| PubChem | 156118 |
| NPASS | NPC6597 |
| ChEMBL | CHEMBL451860 |
| LOTUS | LTS0042811 |
| wikiData | Q104397512 |