phenacyl (2S)-11-cycloheptyl-2-hydroxyundecanoate
| Internal ID | 065a7ce7-e33a-4b50-8386-47eed7ac5d0b |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > Phenylketones > Alkyl-phenylketones |
| IUPAC Name | phenacyl (2S)-11-cycloheptyl-2-hydroxyundecanoate |
| SMILES (Canonical) | C1CCCC(CC1)CCCCCCCCCC(C(=O)OCC(=O)C2=CC=CC=C2)O |
| SMILES (Isomeric) | C1CCCC(CC1)CCCCCCCCC[C@@H](C(=O)OCC(=O)C2=CC=CC=C2)O |
| InChI | InChI=1S/C26H40O4/c27-24(26(29)30-21-25(28)23-18-12-8-13-19-23)20-14-5-3-1-2-4-9-15-22-16-10-6-7-11-17-22/h8,12-13,18-19,22,24,27H,1-7,9-11,14-17,20-21H2/t24-/m0/s1 |
| InChI Key | AREDOQGUDJBGRZ-DEOSSOPVSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H40O4 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.29265975 g/mol |
| Topological Polar Surface Area (TPSA) | 63.60 Ų |
| XlogP | 8.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 97.57% | 94.62% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.17% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.17% | 98.95% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 93.75% | 94.08% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 93.50% | 94.23% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.99% | 93.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.28% | 97.09% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 90.92% | 85.31% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.16% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.07% | 95.56% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 87.84% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.41% | 91.11% |
| CHEMBL6007 | O75762 | Transient receptor potential cation channel subfamily A member 1 | 87.15% | 92.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.04% | 86.33% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.18% | 100.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.86% | 98.75% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 84.08% | 92.97% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.00% | 95.50% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 82.61% | 83.00% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 82.07% | 100.00% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 81.94% | 89.67% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.59% | 100.00% |
| CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 80.90% | 94.97% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.68% | 90.17% |
| CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 80.19% | 91.43% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.05% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162904553 |
| LOTUS | LTS0069649 |
| wikiData | Q104917259 |