L-Phenylalanyl-L-alanine
| Internal ID | 800eee28-adb7-4d18-b7d2-fb8de6a86bdd |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Dipeptides |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]propanoic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C12H16N2O3/c1-8(12(16)17)14-11(15)10(13)7-9-5-3-2-4-6-9/h2-6,8,10H,7,13H2,1H3,(H,14,15)(H,16,17)/t8-,10-/m0/s1 |
| InChI Key | MIDZLCFIAINOQN-WPRPVWTQSA-N |
| Popularity | 141 references in papers |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.11609238 g/mol |
| Topological Polar Surface Area (TPSA) | 92.40 Ų |
| XlogP | -2.90 |
| 3918-87-4 |
| Phenylalanylalanine |
| H-PHE-ALA-OH |
| L-Phenylalanyl-L-alanine |
| (S)-2-((S)-2-Amino-3-phenylpropanamido)propanoic acid |
| (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]propanoic acid |
| CHEMBL429950 |
| CHEBI:73630 |
| FA dipeptide |
| F-A Dipeptide |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.02% | 98.95% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.18% | 90.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.31% | 96.09% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 92.76% | 90.20% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 89.02% | 100.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.55% | 95.50% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.25% | 95.56% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 87.13% | 92.29% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.21% | 93.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.12% | 94.73% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.65% | 99.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.40% | 91.11% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.79% | 97.21% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 80.46% | 83.82% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 5488196 |
| LOTUS | LTS0038836 |
| wikiData | Q27142042 |