Phayomphenol A1
| Internal ID | 943d9da3-c813-4597-9745-6b271793c828 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 2-benzopyrans |
| IUPAC Name | (3R,4S)-3-acetyl-5,7-dihydroxy-4-(4-hydroxyphenyl)-3,4-dihydroisochromen-1-one |
| SMILES (Canonical) | CC(=O)C1C(C2=C(C=C(C=C2O)O)C(=O)O1)C3=CC=C(C=C3)O |
| SMILES (Isomeric) | CC(=O)[C@H]1[C@H](C2=C(C=C(C=C2O)O)C(=O)O1)C3=CC=C(C=C3)O |
| InChI | InChI=1S/C17H14O6/c1-8(18)16-14(9-2-4-10(19)5-3-9)15-12(17(22)23-16)6-11(20)7-13(15)21/h2-7,14,16,19-21H,1H3/t14-,16-/m0/s1 |
| InChI Key | ULVDXYXKRNQCCO-HOCLYGCPSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C17H14O6 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.07903816 g/mol |
| Topological Polar Surface Area (TPSA) | 104.00 Ų |
| XlogP | 2.00 |
| Phayomphenol A1 |
| BDBM50362639 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.57% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 94.96% | 91.49% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.58% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.13% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.74% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.93% | 96.09% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.32% | 94.73% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.04% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.55% | 86.33% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.76% | 99.15% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 80.73% | 85.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Anthoshorea roxburghii |
| PubChem | 57391943 |
| LOTUS | LTS0071749 |
| wikiData | Q105275371 |