Phakellistatin 17
| Internal ID | a3558787-cdc1-495f-b394-afd7c06192a9 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | (3S,6S,12S,15S,18S,24S,27S,30S)-3,12-bis[(2S)-butan-2-yl]-27-(1H-indol-3-ylmethyl)-15-(2-methylpropyl)-24-propan-2-yl-1,4,10,13,16,22,25,28-octazatetracyclo[28.3.0.06,10.018,22]tritriacontane-2,5,11,14,17,23,26,29-octone |
| SMILES (Canonical) | CCC(C)C1C(=O)N2CCCC2C(=O)NC(C(=O)NC(C(=O)N3CCCC3C(=O)NC(C(=O)NC(C(=O)N4CCCC4C(=O)N1)C(C)CC)CC(C)C)C(C)C)CC5=CNC6=CC=CC=C65 |
| SMILES (Isomeric) | CC[C@H](C)[C@H]1C(=O)N2CCC[C@H]2C(=O)N[C@H](C(=O)N[C@H](C(=O)N3CCC[C@H]3C(=O)N[C@H](C(=O)N[C@H](C(=O)N4CCC[C@H]4C(=O)N1)[C@@H](C)CC)CC(C)C)C(C)C)CC5=CNC6=CC=CC=C65 |
| InChI | InChI=1S/C49H73N9O8/c1-9-29(7)40-48(65)58-23-15-20-38(58)46(63)55-41(30(8)10-2)49(66)57-22-14-19-37(57)45(62)52-35(25-31-26-50-33-17-12-11-16-32(31)33)43(60)53-39(28(5)6)47(64)56-21-13-18-36(56)44(61)51-34(24-27(3)4)42(59)54-40/h11-12,16-17,26-30,34-41,50H,9-10,13-15,18-25H2,1-8H3,(H,51,61)(H,52,62)(H,53,60)(H,54,59)(H,55,63)/t29-,30-,34-,35-,36-,37-,38-,39-,40-,41-/m0/s1 |
| InChI Key | MZDYKBQADUUMIO-KJCFDAGBSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C49H73N9O8 |
| Molecular Weight | 916.20 g/mol |
| Exact Mass | 915.55821032 g/mol |
| Topological Polar Surface Area (TPSA) | 222.00 Ų |
| XlogP | 5.50 |
| CHEMBL1099232 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.72% | 98.95% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 99.21% | 96.31% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.50% | 91.11% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 97.42% | 94.75% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.12% | 96.09% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 96.98% | 90.08% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.22% | 95.56% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 95.66% | 88.56% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 94.95% | 92.97% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 94.87% | 97.64% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 94.42% | 92.12% |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 93.98% | 90.71% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.75% | 97.09% |
| CHEMBL228 | P31645 | Serotonin transporter | 92.83% | 95.51% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.49% | 97.25% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.30% | 95.89% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 88.24% | 99.18% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.97% | 93.99% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 87.92% | 91.76% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 87.82% | 83.10% |
| CHEMBL3837 | P07711 | Cathepsin L | 87.47% | 96.61% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 87.39% | 97.05% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.25% | 89.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.12% | 94.45% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 86.42% | 82.38% |
| CHEMBL1949 | P62937 | Cyclophilin A | 86.15% | 98.57% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.94% | 85.14% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.38% | 92.62% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 85.07% | 95.56% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 84.53% | 98.33% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 84.51% | 93.03% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 84.49% | 95.83% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 83.47% | 95.71% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.06% | 99.23% |
| CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 83.00% | 91.43% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 82.92% | 89.62% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 82.64% | 92.67% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 82.43% | 97.79% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 82.41% | 94.66% |
| CHEMBL2189110 | Q15910 | Histone-lysine N-methyltransferase EZH2 | 82.35% | 97.50% |
| CHEMBL2443 | P49862 | Kallikrein 7 | 81.32% | 94.00% |
| CHEMBL6175 | Q9H3R0 | Lysine-specific demethylase 4C | 81.00% | 96.69% |
| CHEMBL1808 | P12821 | Angiotensin-converting enzyme | 80.34% | 93.39% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 46209787 |
| LOTUS | LTS0034277 |
| wikiData | Q105175399 |