Pezizolide E
| Internal ID | 1ef89102-c605-4a0c-b06f-b1f54b2ed897 |
| Taxonomy | Organoheterocyclic compounds > Dihydrofurans > Furanones > Butenolides |
| IUPAC Name | 3-[(1R,2S)-1,2-dihydroxybutyl]-4-prop-1-enyl-2H-furan-5-one |
| SMILES (Canonical) | CCC(C(C1=C(C(=O)OC1)C=CC)O)O |
| SMILES (Isomeric) | CC[C@@H]([C@@H](C1=C(C(=O)OC1)C=CC)O)O |
| InChI | InChI=1S/C11H16O4/c1-3-5-7-8(6-15-11(7)14)10(13)9(12)4-2/h3,5,9-10,12-13H,4,6H2,1-2H3/t9-,10+/m0/s1 |
| InChI Key | OSXQNTNIPHVDFK-VHSXEESVSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10485899 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 0.20 |
| 3-((1R,2S)-1,2-dihydroxybutyl)-4-prop-1-enyl-2H-furan-5-one |
| 3-[(1R,2S)-1,2-dihydroxybutyl]-4-prop-1-enyl-2H-furan-5-one |
| RefChem:172211 |
| CHEBI:199405 |
| 3-[(1R,2S)-1,2-dihydroxybutyl]-4-prop-1-enyl-2H-uran-5-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 95.99% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.30% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.93% | 91.11% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.59% | 94.73% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.10% | 95.56% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 86.77% | 97.21% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.23% | 89.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.26% | 97.25% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.65% | 86.33% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.54% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139583701 |
| LOTUS | LTS0123862 |
| wikiData | Q75065590 |