Petiolin G
Internal ID | 23588aa5-5959-48ae-af96-8bb8a609b564 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
IUPAC Name | [(2S,3R,4S,5R,6S)-6-[2-(3,5-dihydroxybenzoyl)-3,5-dihydroxyphenoxy]-4,5-dihydroxy-2-methyloxan-3-yl] acetate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=CC(=CC(=C2C(=O)C3=CC(=CC(=C3)O)O)O)O)O)O)OC(=O)C |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC2=CC(=CC(=C2C(=O)C3=CC(=CC(=C3)O)O)O)O)O)O)OC(=O)C |
InChI | InChI=1S/C21H22O11/c1-8-20(31-9(2)22)18(28)19(29)21(30-8)32-15-7-13(25)6-14(26)16(15)17(27)10-3-11(23)5-12(24)4-10/h3-8,18-21,23-26,28-29H,1-2H3/t8-,18-,19+,20-,21-/m0/s1 |
InChI Key | SWBFCDGWUODLEJ-YKTMWWCPSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H22O11 |
Molecular Weight | 450.40 g/mol |
Exact Mass | 450.11621151 g/mol |
Topological Polar Surface Area (TPSA) | 183.00 Ų |
XlogP | 1.30 |
AKOS040736173 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.31% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.85% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.16% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.07% | 86.33% |
CHEMBL3194 | P02766 | Transthyretin | 90.65% | 90.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.52% | 99.17% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.38% | 90.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.03% | 94.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.13% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.72% | 95.56% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.68% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 85.10% | 98.95% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.70% | 92.94% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 81.04% | 81.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Hypericum pseudopetiolatum |
PubChem | 44473623 |
LOTUS | LTS0212439 |
wikiData | Q105262576 |