Petalopurpurenol
| Internal ID | 5d80aef7-ae8d-4ab2-80fe-5b33b396d6f2 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Pyranoflavonoids |
| IUPAC Name | 3,5,7-trihydroxy-2-[8-hydroxy-2-methyl-2-(4-methylpent-3-enyl)chromen-5-yl]chromen-4-one |
| SMILES (Canonical) | CC(=CCCC1(C=CC2=C(C=CC(=C2O1)O)C3=C(C(=O)C4=C(C=C(C=C4O3)O)O)O)C)C |
| SMILES (Isomeric) | CC(=CCCC1(C=CC2=C(C=CC(=C2O1)O)C3=C(C(=O)C4=C(C=C(C=C4O3)O)O)O)C)C |
| InChI | InChI=1S/C25H24O7/c1-13(2)5-4-9-25(3)10-8-16-15(6-7-17(27)23(16)32-25)24-22(30)21(29)20-18(28)11-14(26)12-19(20)31-24/h5-8,10-12,26-28,30H,4,9H2,1-3H3 |
| InChI Key | LBBKHSYDJWHLOM-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C25H24O7 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.15220310 g/mol |
| Topological Polar Surface Area (TPSA) | 116.00 Ų |
| XlogP | 5.40 |
| 3,5,7-trihydroxy-2-[8-hydroxy-2-methyl-2-(4-methylpent-3-enyl)chromen-5-yl]chromen-4-one |
| 3,5,7-trihydroxy-2-(8-hydroxy-2-methyl-2-(4-methylpent-3-enyl)chromen-5-yl)chromen-4-one |
| RefChem:172101 |
| 173221-05-1 |
| CHEMBL459115 |
| SCHEMBL27977935 |
| LMPK12112298 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.85% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 99.41% | 91.49% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.79% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.48% | 89.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 95.48% | 94.73% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 95.06% | 96.12% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.00% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.44% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.00% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.81% | 99.17% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.82% | 90.00% |
| CHEMBL3194 | P02766 | Transthyretin | 88.16% | 90.71% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 86.59% | 94.42% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.24% | 90.71% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.71% | 99.15% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 85.57% | 91.38% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.76% | 94.75% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 81.84% | 85.30% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 80.96% | 95.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dalea purpurea var. purpurea |
| PubChem | 10478165 |
| LOTUS | LTS0161405 |
| wikiData | Q105149156 |