Pestalotiopin C
| Internal ID | 0fd0929a-b422-4b57-b9b8-f0e379bbb47f |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
| IUPAC Name | [(4aR,5S,8R,8aR)-8a-hydroxy-3,4a,5-trimethyl-2-oxo-5,6,7,8-tetrahydro-4H-benzo[f][1]benzofuran-8-yl] (E,2R,3S)-6-(acetyloxymethyl)-3-hydroxy-2,4-dimethyldodec-4-enoate |
| SMILES (Canonical) | CCCCCCC(COC(=O)C)C=C(C)C(C(C)C(=O)OC1CCC(C2(C1(C=C3C(=C(C(=O)O3)C)C2)O)C)C)O |
| SMILES (Isomeric) | CCCCCCC(COC(=O)C)/C=C(\C)/[C@H]([C@@H](C)C(=O)O[C@@H]1CC[C@@H]([C@@]2([C@@]1(C=C3C(=C(C(=O)O3)C)C2)O)C)C)O |
| InChI | InChI=1S/C32H48O8/c1-8-9-10-11-12-24(18-38-23(6)33)15-19(2)28(34)22(5)30(36)40-27-14-13-20(3)31(7)16-25-21(4)29(35)39-26(25)17-32(27,31)37/h15,17,20,22,24,27-28,34,37H,8-14,16,18H2,1-7H3/b19-15+/t20-,22+,24?,27+,28+,31+,32-/m0/s1 |
| InChI Key | KQDSRQYBICMLPJ-DWAGUGCHSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C32H48O8 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.33491849 g/mol |
| Topological Polar Surface Area (TPSA) | 119.00 Ų |
| XlogP | 5.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.50% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.35% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.09% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.00% | 97.25% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.89% | 99.17% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 94.25% | 98.03% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.78% | 94.45% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 93.19% | 93.56% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 92.63% | 97.79% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.85% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.84% | 97.09% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 91.17% | 96.47% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 91.06% | 100.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.56% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.31% | 86.33% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 89.90% | 89.63% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 89.41% | 92.86% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.43% | 91.19% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.38% | 85.14% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 88.18% | 100.00% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 87.36% | 90.08% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.58% | 90.17% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.28% | 95.89% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.44% | 89.00% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 84.32% | 91.81% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 84.05% | 97.29% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.41% | 97.14% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.06% | 94.73% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 81.69% | 94.80% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.21% | 93.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.14% | 100.00% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.86% | 82.69% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.66% | 95.89% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.15% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 101965308 |
| LOTUS | LTS0108490 |
| wikiData | Q75057802 |