periglaucine B
Internal ID | a2175845-76b6-41b4-8c78-1cbb83761cd3 |
Taxonomy | Alkaloids and derivatives > Hasubanan alkaloids |
IUPAC Name | (1S,11S,13S,14R,15S)-14,15-dimethoxy-20-methyl-5,7,21-trioxa-20-azahexacyclo[11.4.3.111,14.01,13.02,10.04,8]henicosa-2,4(8),9-trien-16-one |
SMILES (Canonical) | CN1CCC23C14CC(C5=CC6=C(C=C52)OCO6)OC4(C(C(=O)C3)OC)OC |
SMILES (Isomeric) | CN1CC[C@@]23[C@]14C[C@@H](C5=CC6=C(C=C52)OCO6)O[C@]4([C@H](C(=O)C3)OC)OC |
InChI | InChI=1S/C20H23NO6/c1-21-5-4-18-8-13(22)17(23-2)20(24-3)19(18,21)9-16(27-20)11-6-14-15(7-12(11)18)26-10-25-14/h6-7,16-17H,4-5,8-10H2,1-3H3/t16-,17-,18-,19-,20-/m0/s1 |
InChI Key | QJDYNQYLCIPODD-HVTWWXFQSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C20H23NO6 |
Molecular Weight | 373.40 g/mol |
Exact Mass | 373.15253745 g/mol |
Topological Polar Surface Area (TPSA) | 66.50 Ų |
XlogP | 0.70 |
1025023-05-5 |
(1S,11S,13S,14R,15S)-14,15-Dimethoxy-20-methyl-5,7,21-trioxa-20-azahexacyclo[11.4.3.111,14.01,13.02,10.04,8]henicosa-2,4(8),9-trien-16-one |
CHEBI:66732 |
HY-N3093 |
AKOS040762172 |
CS-0023205 |
Q27135354 |
(7,8,10)-8,10-Epoxy-7,8-dimethoxy-17-methyl-2,3-[methylenebis(oxy)]hasubanan-6-one; (+)-Periglaucine B |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 99.26% | 96.77% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.76% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.92% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.03% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 94.74% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.47% | 97.25% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 91.38% | 93.40% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.39% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.83% | 95.56% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 87.17% | 93.04% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.02% | 86.33% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 84.56% | 82.38% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 84.49% | 94.80% |
CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 84.16% | 92.38% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.79% | 89.00% |
CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 83.69% | 92.50% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.25% | 94.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.81% | 92.62% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.80% | 97.14% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.69% | 100.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.36% | 90.71% |
CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 82.30% | 90.95% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 82.14% | 91.03% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 81.88% | 94.78% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.41% | 85.14% |
CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 80.06% | 80.96% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Pericampylus glaucus |
PubChem | 24879470 |
LOTUS | LTS0121057 |
wikiData | Q27135354 |