Peptidolipin E
Internal ID | e33a24dc-3747-4bda-be9b-c326f9314ad2 |
Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
IUPAC Name | (3S,6S,9S,13R,16S,19S,22R,25R)-22-[(2S)-butan-2-yl]-9-[(1R)-1-hydroxyethyl]-16-[(1R)-1-methoxyethyl]-3-methyl-13-[(Z)-pentacos-16-enyl]-6,19-di(propan-2-yl)-14-oxa-1,4,7,10,17,20,23-heptazabicyclo[23.3.0]octacosane-2,5,8,11,15,18,21,24-octone |
SMILES (Canonical) | CCCCCCCCC=CCCCCCCCCCCCCCCCC1CC(=O)NC(C(=O)NC(C(=O)NC(C(=O)N2CCCC2C(=O)NC(C(=O)NC(C(=O)NC(C(=O)O1)C(C)OC)C(C)C)C(C)CC)C)C(C)C)C(C)O |
SMILES (Isomeric) | CCCCCCCC/C=C\CCCCCCCCCCCCCCC[C@@H]1CC(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N2CCC[C@@H]2C(=O)N[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O1)[C@@H](C)OC)C(C)C)[C@@H](C)CC)C)C(C)C)[C@@H](C)O |
InChI | InChI=1S/C61H109N7O11/c1-12-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-29-30-31-32-33-34-35-37-47-40-49(70)63-53(45(9)69)59(75)65-50(41(3)4)56(72)62-44(8)60(76)68-39-36-38-48(68)55(71)66-52(43(7)13-2)58(74)64-51(42(5)6)57(73)67-54(46(10)78-11)61(77)79-47/h20-21,41-48,50-54,69H,12-19,22-40H2,1-11H3,(H,62,72)(H,63,70)(H,64,74)(H,65,75)(H,66,71)(H,67,73)/b21-20-/t43-,44-,45+,46+,47+,48+,50-,51-,52+,53-,54-/m0/s1 |
InChI Key | FDSYBTTXIDEREA-XWTMVZHXSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C61H109N7O11 |
Molecular Weight | 1116.60 g/mol |
Exact Mass | 1115.81850732 g/mol |
Topological Polar Surface Area (TPSA) | 251.00 Ų |
XlogP | 13.80 |
Atomic LogP (AlogP) | 8.15 |
H-Bond Acceptor | 11 |
H-Bond Donor | 7 |
Rotatable Bonds | 30 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | - | 0.5170 | 51.70% |
Caco-2 | - | 0.8565 | 85.65% |
Blood Brain Barrier | - | 0.9000 | 90.00% |
Human oral bioavailability | - | 0.6429 | 64.29% |
Subcellular localzation | Mitochondria | 0.4794 | 47.94% |
OATP2B1 inhibitior | - | 0.8621 | 86.21% |
OATP1B1 inhibitior | + | 0.7821 | 78.21% |
OATP1B3 inhibitior | + | 0.8694 | 86.94% |
MATE1 inhibitior | - | 0.9800 | 98.00% |
OCT2 inhibitior | - | 0.9250 | 92.50% |
BSEP inhibitior | + | 0.9360 | 93.60% |
P-glycoprotein inhibitior | + | 0.7433 | 74.33% |
P-glycoprotein substrate | + | 0.8137 | 81.37% |
CYP3A4 substrate | + | 0.6940 | 69.40% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8488 | 84.88% |
CYP3A4 inhibition | - | 0.7706 | 77.06% |
CYP2C9 inhibition | - | 0.9055 | 90.55% |
CYP2C19 inhibition | - | 0.9237 | 92.37% |
CYP2D6 inhibition | - | 0.9220 | 92.20% |
CYP1A2 inhibition | - | 0.9089 | 90.89% |
CYP2C8 inhibition | + | 0.6082 | 60.82% |
CYP inhibitory promiscuity | - | 0.9800 | 98.00% |
UGT catelyzed | - | 0.6000 | 60.00% |
Carcinogenicity (binary) | - | 0.8900 | 89.00% |
Carcinogenicity (trinary) | Non-required | 0.5824 | 58.24% |
Eye corrosion | - | 0.9880 | 98.80% |
Eye irritation | - | 0.8979 | 89.79% |
Skin irritation | - | 0.7821 | 78.21% |
Skin corrosion | - | 0.9220 | 92.20% |
Ames mutagenesis | - | 0.7815 | 78.15% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.6556 | 65.56% |
Micronuclear | + | 0.7900 | 79.00% |
Hepatotoxicity | + | 0.5323 | 53.23% |
skin sensitisation | - | 0.8800 | 88.00% |
Respiratory toxicity | + | 0.5111 | 51.11% |
Reproductive toxicity | + | 0.8222 | 82.22% |
Mitochondrial toxicity | + | 0.8375 | 83.75% |
Nephrotoxicity | + | 0.4530 | 45.30% |
Acute Oral Toxicity (c) | III | 0.6596 | 65.96% |
Estrogen receptor binding | + | 0.8001 | 80.01% |
Androgen receptor binding | + | 0.6732 | 67.32% |
Thyroid receptor binding | + | 0.5138 | 51.38% |
Glucocorticoid receptor binding | + | 0.6690 | 66.90% |
Aromatase binding | + | 0.6594 | 65.94% |
PPAR gamma | + | 0.7729 | 77.29% |
Honey bee toxicity | - | 0.7801 | 78.01% |
Biodegradation | - | 0.7750 | 77.50% |
Crustacea aquatic toxicity | + | 0.6075 | 60.75% |
Fish aquatic toxicity | + | 0.8305 | 83.05% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.67% | 98.95% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 98.36% | 90.08% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.27% | 96.09% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 97.18% | 82.38% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 96.88% | 92.97% |
CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 95.24% | 94.66% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.14% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.76% | 99.17% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.39% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.12% | 97.09% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 93.88% | 97.05% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 93.51% | 100.00% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 93.11% | 99.18% |
CHEMBL325 | Q13547 | Histone deacetylase 1 | 92.75% | 95.92% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 92.28% | 95.89% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.11% | 97.25% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 91.37% | 95.50% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.61% | 94.75% |
CHEMBL2443 | P49862 | Kallikrein 7 | 90.58% | 94.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.68% | 94.45% |
CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 89.21% | 97.47% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.30% | 95.56% |
CHEMBL1949 | P62937 | Cyclophilin A | 88.12% | 98.57% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 87.25% | 96.47% |
CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 85.98% | 97.64% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 85.81% | 93.03% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.74% | 93.56% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 85.34% | 90.24% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 85.20% | 92.88% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 84.85% | 91.81% |
CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 84.82% | 90.24% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 84.24% | 97.29% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.18% | 93.00% |
CHEMBL2189110 | Q15910 | Histone-lysine N-methyltransferase EZH2 | 83.62% | 97.50% |
CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 83.49% | 95.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.41% | 89.00% |
CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 83.34% | 92.12% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.68% | 86.33% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.60% | 97.14% |
CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 82.25% | 88.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.24% | 90.71% |
CHEMBL1907 | P15144 | Aminopeptidase N | 82.12% | 93.31% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.20% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Delphinium gracile |
PubChem | 57409018 |
LOTUS | LTS0116138 |
wikiData | Q105028793 |