Penupogenin
Internal ID | b28336fa-da87-45f5-9e8c-d8a556933e6f |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Pregnane steroids > Gluco/mineralocorticoids, progestogins and derivatives |
IUPAC Name | [(3S,8S,9R,10R,12R,13R,14R,17S)-3,8,14,17-tetrahydroxy-17-[(1R)-1-hydroxyethyl]-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] (E)-3-phenylprop-2-enoate |
SMILES (Canonical) | CC(C1(CCC2(C1(C(CC3C2(CC=C4C3(CCC(C4)O)C)O)OC(=O)C=CC5=CC=CC=C5)C)O)O)O |
SMILES (Isomeric) | C[C@H]([C@@]1(CC[C@]2([C@@]1([C@@H](C[C@H]3[C@]2(CC=C4[C@@]3(CC[C@@H](C4)O)C)O)OC(=O)/C=C/C5=CC=CC=C5)C)O)O)O |
InChI | InChI=1S/C30H40O7/c1-19(31)28(34)15-16-30(36)27(28,3)24(37-25(33)10-9-20-7-5-4-6-8-20)18-23-26(2)13-12-22(32)17-21(26)11-14-29(23,30)35/h4-11,19,22-24,31-32,34-36H,12-18H2,1-3H3/b10-9+/t19-,22+,23-,24-,26+,27-,28-,29+,30-/m1/s1 |
InChI Key | CSSZPOBBUXFMAA-JWBRRKRUSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C30H40O7 |
Molecular Weight | 512.60 g/mol |
Exact Mass | 512.27740361 g/mol |
Topological Polar Surface Area (TPSA) | 127.00 Ų |
XlogP | 2.30 |
27526-87-0 |
Sarcostin 12-cinnamate |
DTXSID20181946 |
((3S,9R,10R,12R,13S,14R,17R)-3,8,14,17-Tetrahydroxy-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta(a)phenanthren-12-yl) (E)-3-phenylprop-2-enoate |
Pregn-5-ene-3,8,12,14,17,20-hexol, 12-((2E)-3-phenyl-2-propenoate), (3beta,12beta,14beta,17alpha,20S)- |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL221 | P23219 | Cyclooxygenase-1 | 98.28% | 90.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.48% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.30% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.85% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.95% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 94.50% | 98.95% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.86% | 96.00% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 91.26% | 94.08% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 90.46% | 94.62% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 90.14% | 95.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.59% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.13% | 97.09% |
CHEMBL5028 | O14672 | ADAM10 | 88.41% | 97.50% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 88.08% | 100.00% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 87.99% | 96.47% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.05% | 93.56% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 84.00% | 94.23% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.49% | 97.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.45% | 95.89% |
CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 81.95% | 95.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.07% | 93.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.44% | 91.07% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 80.22% | 95.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cynanchum acutum subsp. sibiricum |
Cynanchum gracillimum |
Gymnema sylvestre |
Marsdenia tinctoria |
Marsdenia tomentosa |
PubChem | 56841085 |
LOTUS | LTS0243617 |
wikiData | Q83052599 |