Penifulvin A
| Internal ID | c43842c3-e21b-4afe-93ed-48ee4c8caed3 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
| IUPAC Name | (1R,4S,8R,11S,14S)-8,10,10-trimethyl-3,5-dioxatetracyclo[6.5.1.04,14.011,14]tetradecane-2,6-dione |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H20O4/c1-13(2)7-14(3)6-10(16)18-12-15(14)8(11(17)19-12)4-5-9(13)15/h8-9,12H,4-7H2,1-3H3/t8-,9-,12-,14-,15-/m0/s1 |
| InChI Key | NGAMYGLHRNCUQC-AWPZLMCQSA-N |
| Popularity | 7 references in papers |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.13615911 g/mol |
| Topological Polar Surface Area (TPSA) | 52.60 Ų |
| XlogP | 2.80 |
| (-)-Penifulvin A |
| Penifulvin A [MI] |
| 52YN380XBB |
| UNII-52YN380XBB |
| (2aR,4aS,6aR,9aS,9bS)-Octahydro-5,5,6a-trimethyl-9ah-1,9-dioxapentaleno(1,6-cd)indene-2,8-dione |
| 881880-42-8 |
| 9Ah-1,9-dioxapentaleno(1,6-cd)indene-2,8-dione, octahydro-5,5,6a-trimethyl-, (2aR,4aS,6aR,9aS,9bS)- |
| CHEMBL469405 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.41% | 91.11% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 91.79% | 96.38% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 88.25% | 96.77% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.21% | 97.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.79% | 97.25% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.35% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.90% | 98.95% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 83.31% | 95.92% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 82.56% | 89.34% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.75% | 97.14% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 81.23% | 90.08% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.03% | 89.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.79% | 95.89% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 80.72% | 93.40% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 42604589 |
| LOTUS | LTS0098882 |
| wikiData | Q77518400 |