Penidiamide
| Internal ID | d7907cc3-8cf2-476f-b0f2-a60235c06977 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Benzamides > Hippuric acids and derivatives |
| IUPAC Name | 2-amino-N-[2-[[(E)-2-(1H-indol-3-yl)ethenyl]amino]-2-oxoethyl]benzamide |
| SMILES (Canonical) | C1=CC=C2C(=C1)C(=CN2)C=CNC(=O)CNC(=O)C3=CC=CC=C3N |
| SMILES (Isomeric) | C1=CC=C2C(=C1)C(=CN2)/C=C/NC(=O)CNC(=O)C3=CC=CC=C3N |
| InChI | InChI=1S/C19H18N4O2/c20-16-7-3-1-6-15(16)19(25)23-12-18(24)21-10-9-13-11-22-17-8-4-2-5-14(13)17/h1-11,22H,12,20H2,(H,21,24)(H,23,25)/b10-9+ |
| InChI Key | DCQDGRBMXXRGIN-MDZDMXLPSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.14297583 g/mol |
| Topological Polar Surface Area (TPSA) | 100.00 Ų |
| XlogP | 2.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.84% | 91.11% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.24% | 90.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.06% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.91% | 94.45% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 89.58% | 83.10% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.49% | 94.73% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.71% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.32% | 98.95% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.86% | 98.75% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.20% | 90.00% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 84.77% | 96.67% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 84.41% | 83.82% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 84.28% | 93.81% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.07% | 96.00% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 81.37% | 80.71% |
| CHEMBL2321614 | Q9NPC2 | Potassium channel subfamily K member 9 | 81.16% | 80.00% |
| CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 80.55% | 88.00% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.45% | 89.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10449544 |
| LOTUS | LTS0062822 |
| wikiData | Q77491859 |