Penicimarin D
| Internal ID | 3811bb56-10c7-4bbc-a64c-32cc78bf183c |
| Taxonomy | Phenylpropanoids and polyketides > Isocoumarins and derivatives |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-[(6,8-dihydroxy-3-methyl-1-oxoisochromen-4-yl)methoxy]-3,4,5-trihydroxyoxan-2-yl]methyl acetate |
| SMILES (Canonical) | CC1=C(C2=C(C(=CC(=C2)O)O)C(=O)O1)COC3C(C(C(C(O3)COC(=O)C)O)O)O |
| SMILES (Isomeric) | CC1=C(C2=C(C(=CC(=C2)O)O)C(=O)O1)CO[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)COC(=O)C)O)O)O |
| InChI | InChI=1S/C19H22O11/c1-7-11(10-3-9(21)4-12(22)14(10)18(26)29-7)5-28-19-17(25)16(24)15(23)13(30-19)6-27-8(2)20/h3-4,13,15-17,19,21-25H,5-6H2,1-2H3/t13-,15-,16+,17-,19+/m1/s1 |
| InChI Key | LYSRWWLDCUPVGA-YRHQEJDOSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H22O11 |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.11621151 g/mol |
| Topological Polar Surface Area (TPSA) | 172.00 Ų |
| XlogP | -0.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.27% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 96.26% | 91.49% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.99% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.53% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 93.25% | 94.73% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.05% | 85.14% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 89.82% | 94.80% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.55% | 94.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.87% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.07% | 95.56% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 87.93% | 97.21% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.85% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.70% | 86.33% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.57% | 96.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.04% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.87% | 94.45% |
| CHEMBL3194 | P02766 | Transthyretin | 83.82% | 90.71% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.52% | 97.36% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.33% | 99.15% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.83% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 71664847 |
| LOTUS | LTS0167015 |
| wikiData | Q75069507 |