Penicilindole C
| Internal ID | e2bfd05d-f1bc-4505-b4ce-e1b35d1f0e02 |
| Taxonomy | Organoheterocyclic compounds > Naphthofurans |
| IUPAC Name | (2S,3aS,6R,6aS,9R,10S,10aS)-10-(1H-indol-3-ylmethyl)-6,6a,9-trimethyl-2-(2-methylprop-1-enyl)-2,3a,4,5,6,7,8,10-octahydro-1H-benzo[d][1]benzofuran-9-ol |
| SMILES (Canonical) | CC1CCC2C3(C1(CCC(C3CC4=CNC5=CC=CC=C54)(C)O)C)CC(O2)C=C(C)C |
| SMILES (Isomeric) | C[C@@H]1CC[C@H]2[C@@]3([C@]1(CC[C@@]([C@H]3CC4=CNC5=CC=CC=C54)(C)O)C)C[C@H](O2)C=C(C)C |
| InChI | InChI=1S/C28H39NO2/c1-18(2)14-21-16-28-24(15-20-17-29-23-9-7-6-8-22(20)23)27(5,30)13-12-26(28,4)19(3)10-11-25(28)31-21/h6-9,14,17,19,21,24-25,29-30H,10-13,15-16H2,1-5H3/t19-,21-,24-,25+,26+,27-,28-/m1/s1 |
| InChI Key | XHGDWOIUBXSXIP-JTACFZARSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C28H39NO2 |
| Molecular Weight | 421.60 g/mol |
| Exact Mass | 421.298079487 g/mol |
| Topological Polar Surface Area (TPSA) | 45.20 Ų |
| XlogP | 6.30 |
| (2S,3aS,6R,6aS,9R,10S,10aS)-10-(1H-indol-3-ylmethyl)-6,6a,9-trimethyl-2-(2-methylprop-1-enyl)-2,3a,4,5,6,7,8,10-octahydro-1H-benzo(d)(1)benzofuran-9-ol |
| (2S,3aS,6R,6aS,9R,10S,10aS)-10-(1H-indol-3-ylmethyl)-6,6a,9-trimethyl-2-(2-methylprop-1-enyl)-2,3a,4,5,6,7,8,10-octahydro-1H-benzo[d][1]benzofuran-9-ol |
| RefChem:170875 |
| CHEBI:209240 |
| (2S,3aS,6R,6aS,9R,10S,10aS)-10-(1H-indol-3-ylmethyl)-6,6a,9-trimethyl-2-(2-methylprop-1-enyl)-2,3a,4,5,6,7,8,10-octahydro-1H-benzo[d][1]benzouran-9-ol |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.71% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.49% | 96.09% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 93.58% | 92.62% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.54% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.39% | 97.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.46% | 98.95% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 92.23% | 88.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.14% | 89.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.88% | 93.99% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 90.80% | 97.79% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.28% | 94.75% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.97% | 100.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 86.04% | 91.49% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 85.77% | 96.39% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.72% | 96.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.19% | 94.45% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 83.45% | 89.62% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.84% | 95.89% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.86% | 91.71% |
| CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 81.59% | 95.00% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 81.15% | 89.44% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.89% | 86.33% |
| CHEMBL240 | Q12809 | HERG | 80.23% | 89.76% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 80.15% | 95.00% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 80.01% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139589955 |
| LOTUS | LTS0128767 |
| wikiData | Q105328093 |