Pellotine
Internal ID | 7f625822-0f99-4150-b6fe-79d128ffe678 |
Taxonomy | Organoheterocyclic compounds > Tetrahydroisoquinolines |
IUPAC Name | 6,7-dimethoxy-1,2-dimethyl-3,4-dihydro-1H-isoquinolin-8-ol |
SMILES (Canonical) | CC1C2=C(C(=C(C=C2CCN1C)OC)OC)O |
SMILES (Isomeric) | CC1C2=C(C(=C(C=C2CCN1C)OC)OC)O |
InChI | InChI=1S/C13H19NO3/c1-8-11-9(5-6-14(8)2)7-10(16-3)13(17-4)12(11)15/h7-8,15H,5-6H2,1-4H3 |
InChI Key | NKHMWHLJHODBEP-UHFFFAOYSA-N |
Popularity | 62 references in papers |
Molecular Formula | C13H19NO3 |
Molecular Weight | 237.29 g/mol |
Exact Mass | 237.13649347 g/mol |
Topological Polar Surface Area (TPSA) | 41.90 Ų |
XlogP | 1.80 |
Methylanhalonidine |
CHEMBL5195212 |
DTXSID50871560 |
NKHMWHLJHODBEP-UHFFFAOYSA-N |
6,7-dimethoxy-1,2-dimethyl-3,4-dihydro-1H-isoquinolin-8-ol |
Q15425290 |
6,7-Dimethoxy-1,2-dimethyl-1,2,3,4-tetrahydroisoquinolin-8-ol |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.62% | 96.09% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 91.13% | 93.40% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.07% | 91.11% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 90.69% | 97.31% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.60% | 85.14% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 90.09% | 91.00% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 89.75% | 95.62% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 89.64% | 92.94% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 89.64% | 91.03% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.26% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.94% | 90.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.14% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.40% | 95.89% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.12% | 93.99% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.63% | 94.00% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 82.10% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.44% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lophophora williamsii |
Pachycereus weberi |
PubChem | 65742 |
LOTUS | LTS0078592 |
wikiData | Q15425290 |