Patuletin 3-glucosyl-(1-->6)[apiosyl(1-->2)]glucoside
Internal ID | f5a980fe-4c82-4973-90eb-81cd1d212b77 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | 3-[(2S,3R,4S,5S,6R)-3-[(2S,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-4,5-dihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxy-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-6-methoxychromen-4-one |
SMILES (Canonical) | COC1=C(C2=C(C=C1O)OC(=C(C2=O)OC3C(C(C(C(O3)COC4C(C(C(C(O4)CO)O)O)O)O)O)OC5C(C(CO5)(CO)O)O)C6=CC(=C(C=C6)O)O)O |
SMILES (Isomeric) | COC1=C(C2=C(C=C1O)OC(=C(C2=O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O)O)O[C@H]5[C@@H]([C@](CO5)(CO)O)O)C6=CC(=C(C=C6)O)O)O |
InChI | InChI=1S/C33H40O22/c1-48-26-13(38)5-14-17(20(26)41)21(42)27(25(51-14)10-2-3-11(36)12(37)4-10)54-31-28(55-32-29(46)33(47,8-35)9-50-32)23(44)19(40)16(53-31)7-49-30-24(45)22(43)18(39)15(6-34)52-30/h2-5,15-16,18-19,22-24,28-32,34-41,43-47H,6-9H2,1H3/t15-,16-,18-,19-,22+,23+,24-,28-,29+,30-,31+,32+,33-/m1/s1 |
InChI Key | IQBTXBIIGNASBG-TVOXTKHZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C33H40O22 |
Molecular Weight | 788.70 g/mol |
Exact Mass | 788.20112290 g/mol |
Topological Polar Surface Area (TPSA) | 354.00 Ų |
XlogP | -3.00 |
DTXSID101232883 |
AKOS040738470 |
Patuletin 3-glucosyl-(1-->6)[apiosyl(1-->2)]glucoside |
101021-30-1 |
![2D Structure of Patuletin 3-glucosyl-(1-->6)[apiosyl(1-->2)]glucoside 2D Structure of Patuletin 3-glucosyl-(1-->6)[apiosyl(1-->2)]glucoside](https://plantaedb.com/storage/docs/compounds/2023/11/patuletin-3-glucosyl-1-6apiosyl1-2glucoside.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.92% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.50% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.17% | 94.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.90% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 94.65% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.63% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.06% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.75% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.04% | 85.14% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.96% | 99.15% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.10% | 96.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 89.13% | 95.93% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 87.81% | 94.33% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 86.94% | 95.83% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 85.70% | 91.49% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.64% | 99.23% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.64% | 96.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.46% | 95.89% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.01% | 86.92% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.55% | 94.73% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.19% | 94.75% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.15% | 100.00% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 81.60% | 95.53% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.26% | 90.00% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.24% | 96.90% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Spinacia oleracea |
PubChem | 21676299 |
LOTUS | LTS0206082 |
wikiData | Q105117658 |